CAS 33909-74-9
:(6aR,12aR)-2-(3-methylbut-2-en-1-yl)-6a,12a-dihydro-6H-[1,3]dioxolo[5,6][1]benzofuro[3,2-c]chromen-3-ol
Description:
The chemical substance known as "(6aR,12aR)-2-(3-methylbut-2-en-1-yl)-6a,12a-dihydro-6H-[1,3]dioxolo[5,6][1]benzofuro[3,2-c]chromen-3-ol," with the CAS number 33909-74-9, is a complex organic compound characterized by its unique structural features, including a fused dioxole and benzofurochromene framework. This compound exhibits a chiral center, which contributes to its stereochemistry, specifically the (6aR,12aR) configuration. It is likely to possess various functional groups, including hydroxyl (-OH) and alkenyl groups, which may influence its reactivity and interactions. The presence of the dioxole ring suggests potential for interesting electronic properties and reactivity patterns. Such compounds often exhibit biological activity, making them of interest in medicinal chemistry and pharmacology. Additionally, the presence of the 3-methylbut-2-en-1-yl substituent may enhance lipophilicity, affecting solubility and bioavailability. Overall, this compound's intricate structure and functional groups suggest a range of potential applications in various fields, including drug development and materials science.
Formula:C21H20O5
InChI:InChI=1/C21H20O5/c1-11(2)3-4-12-5-14-17(7-16(12)22)23-9-15-13-6-19-20(25-10-24-19)8-18(13)26-21(14)15/h3,5-8,15,21-22H,4,9-10H2,1-2H3/t15-,21-/m0/s1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Edunol
CAS:<p>Edunol is a pterocarpan isolated from Harpalyce brasiliana. It has shown antimyotoxic, antiproteolytic and PLA2 inhibitor properties.</p>Formula:C21H20O5Color and Shape:SolidMolecular weight:352.38
