CAS 339097-11-9
:Ethyl 3-cyano-4-(dimethylamino)-2-oxo-3-butenoate
Description:
Ethyl 3-cyano-4-(dimethylamino)-2-oxo-3-butenoate, identified by its CAS number 339097-11-9, is an organic compound characterized by its functional groups and structural features. It contains a cyano group (-CN), a dimethylamino group (-N(CH3)2), and an ester functional group, which contribute to its reactivity and potential applications in organic synthesis. The compound features a butenoate backbone, indicating it has unsaturation that can participate in various chemical reactions, such as Michael additions or nucleophilic attacks. Its molecular structure suggests it may exhibit polar characteristics due to the presence of the cyano and dimethylamino groups, influencing its solubility in polar solvents. Additionally, the compound may display biological activity, making it of interest in pharmaceutical research. Safety and handling precautions should be observed, as with many organic compounds, due to potential toxicity or reactivity. Overall, Ethyl 3-cyano-4-(dimethylamino)-2-oxo-3-butenoate is a versatile compound with significant implications in synthetic chemistry and medicinal applications.
Formula:C9H12N2O3
InChI:InChI=1S/C9H12N2O3/c1-4-14-9(13)8(12)7(5-10)6-11(2)3/h6H,4H2,1-3H3
InChI key:InChIKey=NYQIQMRBHIKESF-UHFFFAOYSA-N
SMILES:C(C(C(OCC)=O)=O)(=CN(C)C)C#N
Synonyms:- Ethyl 3-cyano-4-(dimethylamino)-2-oxo-3-butenoate
- 3-Butenoic acid, 3-cyano-4-(dimethylamino)-2-oxo-, ethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Ethyl 3-cyano-4-(dimethylamino)-2-oxobut-3-enoate
CAS:<p>Ethyl 3-cyano-4-(dimethylamino)-2-oxobut-3-enoate</p>Molecular weight:196.20g/mol
