CAS 3391-75-1
:2-methoxy-4-(2-phenylethenyl)phenol
Description:
2-Methoxy-4-(2-phenylethenyl)phenol, also known by its CAS number 3391-75-1, is an organic compound characterized by its phenolic structure. This compound features a methoxy group (-OCH3) and a styryl group (2-phenylethenyl) attached to a phenolic ring, which contributes to its unique chemical properties. It is typically a solid at room temperature and may exhibit a range of colors depending on its purity and specific formulation. The presence of the methoxy group enhances its solubility in organic solvents, while the phenolic hydroxyl group can participate in hydrogen bonding, influencing its reactivity and interactions with other substances. This compound may exhibit antioxidant properties and has potential applications in pharmaceuticals, cosmetics, and materials science. Its synthesis often involves reactions such as alkylation or coupling of phenolic derivatives. As with many organic compounds, safety precautions should be taken when handling it, as it may pose health risks if ingested or inhaled.
Formula:C15H14O2
InChI:InChI=1/C15H14O2/c1-17-15-11-13(9-10-14(15)16)8-7-12-5-3-2-4-6-12/h2-11,16H,1H3
SMILES:COc1cc(C=Cc2ccccc2)ccc1O
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
4-Hydroxy-3-methoxystilbene
CAS:<p>4-Hydroxy-3-methoxystilbene is a natural phenolic compound found in plants. It is an olefinic peroxide that is unreactive and pressurized under normal conditions. It has been isolated from the leaves of the plant, Stilbocarpa erythrophylla, which grows in the tropical forests of Malaysia. The structure of 4-hydroxy-3-methoxystilbene was determined by chromatographic analysis and hydrogen peroxide plates. Phase chromatography was used to separate 4-hydroxy-3-methoxystilbene from other compounds with similar structures, such as acetylated flavonoids or hydroxylated flavonoids. The melting point of 4-hydroxy-3-methoxystilbene was determined by temperature measurements, and its ultraviolet spectrophotometry was used to detect the presence of a hydroxyl group in its chemical structure.</p>Formula:C15H14O2Purity:Min. 95%Color and Shape:PowderMolecular weight:226.27 g/mol
