CAS 3391-87-5
:D-Menthone
Description:
D-Menthone is a naturally occurring monoterpene ketone, primarily derived from mint oils, particularly peppermint. It is characterized by its pleasant minty aroma and flavor, making it a popular ingredient in the food, fragrance, and cosmetic industries. D-Menthone has a molecular formula of C10H18O and features a bicyclic structure, which contributes to its unique properties. It is typically a colorless to pale yellow liquid with a relatively low boiling point, indicating volatility. D-Menthone is known for its potential therapeutic properties, including antimicrobial and anti-inflammatory effects, and is often studied for its applications in aromatherapy and natural medicine. Additionally, it exhibits solubility in organic solvents while being less soluble in water. Safety data indicates that D-Menthone should be handled with care, as it can cause skin irritation in some individuals. Overall, D-Menthone is valued for its sensory attributes and potential health benefits, making it a versatile compound in various industries.
Formula:C10H18O
InChI:InChI=1/C10H18O/c1-7(2)9-5-4-8(3)6-10(9)11/h7-9H,4-6H2,1-3H3
InChI key:InChIKey=NFLGAXVYCFJBMK-DTWKUNHWSA-N
SMILES:C(C)(C)[C@@H]1C(=O)C[C@@H](C)CC1
Synonyms:- (+)-Menthone
- p-Menthan-3-one, (1S,4R)-(+)-
- Cyclohexanone, 5-methyl-2-(1-methylethyl)-, (2R,5S)-
- (2R,5S)-5-Methyl-2-(1-methylethyl)cyclohexanone
- Cyclohexanone, 5-methyl-2-(1-methylethyl)-, (2R-trans)-
- (2R,5S)-2-ISOPROPYL-5-METHYLCYCLOHEXANONE
- (+)-Menthone analytical standard
- (1S)-trans-p-menthan-3-one
- (1S,4R)-p-Menthan-3-one, (2R,5S)-2-Isopropyl-5-methylcyclohexanone
- (1S,4R)-p-Menthane-3-one
- (2R,5S)-2-isopropyl-5-methylcyclohexan-1-one
- (2R)-5α-Methyl-2β-(1-methylethyl)cyclohexanone
- See more synonyms
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.

