CAS 339115-12-7

4-(4-Fluorobenzoyl)-α-(4-fluorophenyl)benzeneacetonitrile

Description:

4-(4-Fluorobenzoyl)-α-(4-fluorophenyl)benzeneacetonitrile, identified by its CAS number 339115-12-7, is a synthetic organic compound characterized by its complex structure, which includes multiple aromatic rings and functional groups. This compound features a fluorobenzoyl group and a nitrile functional group, contributing to its potential reactivity and solubility properties. The presence of fluorine atoms enhances its lipophilicity and may influence its biological activity, making it of interest in pharmaceutical research. Typically, compounds like this may exhibit properties such as moderate to high melting points and solubility in organic solvents, depending on the specific interactions of the functional groups. Its synthesis often involves multi-step organic reactions, and it may be utilized in various applications, including medicinal chemistry and material science. As with many fluorinated compounds, it may also exhibit unique electronic properties, which can be advantageous in designing molecules for specific interactions in biological systems. Safety and handling precautions are essential due to the potential toxicity associated with nitriles and fluorinated compounds.

Formula: C₂₁H₁₃F₂NO

InChI: InChI=1S/C21H13F2NO/c22-18-9-5-15(6-10-18)20(13-24)14-1-3-16(4-2-14)21(25)17-7-11-19(23)12-8-17/h1-12,20H

InChI key: InChIKey=NSLYLZYECDXPAV-UHFFFAOYSA-N

SMILES: C(C#N)(C1=CC=C(C(=O)C2=CC=C(F)C=C2)C=C1)C3=CC=C(F)C=C3

Synonyms:

• Benzeneacetonitrile, 4-(4-fluorobenzoyl)-α-(4-fluorophenyl)-
• 4-(4-Fluorobenzoyl)-α-(4-fluorophenyl)benzeneacetonitrile
• 2-[4-(4-Fluorobenzoyl)phenyl]-2-(4-fluorophenyl)acetonitrile

2-[4-(4-Fluorobenzoyl)phenyl]-2-(4-fluorophenyl)acetonitrile

CAS: 339115-12-7

2-[4-(4-Fluorobenzoyl)phenyl]-2-(4-fluorophenyl)acetonitrile

Purity: 97%

Molecular weight: 333.33g/mol

Ref: 54-PC9320