CAS 33912-87-7
:N-[(Phenylmethoxy)carbonyl]glycyl-L-valine
Description:
N-[(Phenylmethoxy)carbonyl]glycyl-L-valine, with the CAS number 33912-87-7, is a synthetic compound that belongs to the class of amino acid derivatives. This substance features a glycine residue linked to L-valine, with a phenylmethoxycarbonyl (PMOC) protecting group. The PMOC group enhances the compound's stability and solubility, making it useful in peptide synthesis and pharmaceutical applications. The presence of the phenyl group contributes to its hydrophobic characteristics, while the methoxy group can influence its reactivity and interaction with biological systems. This compound is typically utilized in research settings, particularly in studies related to peptide chemistry and drug development. Its structural complexity allows for various modifications, which can be tailored for specific applications in medicinal chemistry. As with many amino acid derivatives, it may exhibit biological activity, although specific pharmacological properties would require further investigation. Proper handling and storage conditions are essential to maintain its integrity and efficacy in laboratory settings.
Formula:C15H20N2O5
InChI:InChI=1S/C15H20N2O5/c1-10(2)13(14(19)20)17-12(18)8-16-15(21)22-9-11-6-4-3-5-7-11/h3-7,10,13H,8-9H2,1-2H3,(H,16,21)(H,17,18)(H,19,20)/t13-/m0/s1
InChI key:InChIKey=RQLYPCLOROQBGI-ZDUSSCGKSA-N
SMILES:[C@H](NC(CNC(OCC1=CC=CC=C1)=O)=O)([C@H](C)C)C(O)=O
Synonyms:- (2S)-3-Methyl-2-[[2-(phenylmethoxycarbonylamino)acetyl]amino]butanoic acid
- <span class="text-smallcaps">L</span>-Valine, N-[(phenylmethoxy)carbonyl]glycyl-
- <span class="text-smallcaps">L</span>-Valine, N-[N-[(phenylmethoxy)carbonyl]glycyl]-
- N-(Benzyloxycarbonyl)glycyl-<span class="text-smallcaps">L</span>-valine
- N-(N-((Benzyloxy)carbonyl)glycyl)-L-valine
- N-[(Phenylmethoxy)carbonyl]glycyl-<span class="text-smallcaps">L</span>-valine
- N-[(benzyloxy)carbonyl]glycylvaline
- Valine, N-(N-carboxyglycyl)-, N-benzyl ester, <span class="text-smallcaps">L</span>-
- Valine, N-(N-carboxyglycyl)-, N-benzyl ester, L-
- N-[(Phenylmethoxy)carbonyl]glycyl-L-valine
- L-Valine, N-[(phenylmethoxy)carbonyl]glycyl-
- L-Valine, N-[N-[(phenylmethoxy)carbonyl]glycyl]-
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
(S)-2-(2-(((Benzyloxy)carbonyl)amino)acetamido)-3-methylbutanoic acid
CAS:Formula:C15H20N2O5Color and Shape:SolidMolecular weight:308.3297Z-Gly-Val-OH
CAS:<p>Z-Gly-Val-OH is an inhibitor that can be used for the synthesis of peptides. It is a c-terminal amino acid with an optically active, cyclic structure. Z-Gly-Val-OH can be coupled to azide and spheric amino acids, and it undergoes racemization in solvents containing additives. This reagent can also be used for the synthesis of peptides with epimerization or chlorine.</p>Formula:C15H20N2O5Purity:Min. 95%Color and Shape:PowderMolecular weight:308.33 g/mol

