CAS 339151-88-1

Methyl 2-chloro-4,6-dimethylnicotinate

Description:

Methyl 2-chloro-4,6-dimethylnicotinate is a chemical compound that belongs to the class of nicotinic acid derivatives. It features a pyridine ring, which is characteristic of nicotinic compounds, and is substituted with a chlorine atom and two methyl groups at specific positions on the ring. This compound is typically a pale yellow to brown solid or liquid, depending on its purity and form. It is soluble in organic solvents, such as ethanol and acetone, but has limited solubility in water. The presence of the chlorine atom introduces unique reactivity, making it useful in various synthetic applications, particularly in medicinal chemistry and the development of pharmaceuticals. Methyl 2-chloro-4,6-dimethylnicotinate may exhibit biological activity, potentially influencing its use in research related to nicotinic receptors or other pharmacological targets. As with many chemical substances, proper handling and safety precautions are essential due to potential toxicity or reactivity.

Formula: C₉H₁₀ClNO₂

InChI: InChI=1S/C9H10ClNO2/c1-5-4-6(2)11-8(10)7(5)9(12)13-3/h4H,1-3H3

SMILES: Cc1cc(C)nc(c1C(=O)OC)Cl

Methyl 2-chloro-4,6-dimethylnicotinate

CAS: 339151-88-1

Methyl 2-chloro-4,6-dimethylnicotinate

Purity: 95%

Molecular weight: 199.64g/mol

Ref: 54-OR1045573

Methyl 2-chloro-4,6-dimethylnicotinate

CAS: 339151-88-1

Formula: C₉H₁₀ClNO₂

Purity: 95.0%

Color and Shape: Liquid

Molecular weight: 199.63

Ref: 10-F335420

Methyl 2-chloro-4,6-dimethylnicotinate

CAS: 339151-88-1

Versatile small molecule scaffold

Formula: C₉H₁₀ClNO₂

Purity: Min. 95%

Molecular weight: 199.63 g/mol

Ref: 3D-PNA15188