CAS 33927-05-8

Methyl 3,5-dinitro-4-hydroxybenzoate

Description:

Methyl 3,5-dinitro-4-hydroxybenzoate, with the CAS number 33927-05-8, is an organic compound that belongs to the class of benzoates. It features a benzoic acid derivative structure, characterized by the presence of a methoxy group (–OCH3), two nitro groups (–NO2) at the 3 and 5 positions, and a hydroxy group (–OH) at the 4 position of the benzene ring. This compound is typically a yellow crystalline solid, indicating the presence of nitro groups, which often impart color to organic compounds. It is known for its applications in organic synthesis and as an intermediate in the production of various chemical products. The presence of multiple functional groups suggests that it may exhibit interesting chemical reactivity, including potential for electrophilic substitution reactions. Additionally, due to the nitro groups, it may also possess explosive properties under certain conditions, necessitating careful handling and storage. Overall, Methyl 3,5-dinitro-4-hydroxybenzoate is a compound of interest in both synthetic organic chemistry and materials science.

Formula: C₈H₆N₂O₇

InChI: InChI=1/C8H6N2O7/c1-17-8(12)4-2-5(9(13)14)7(11)6(3-4)10(15)16/h2-3,11H,1H3

SMILES: COC(=O)c1cc(c(c(c1)N(=O)=O)O)N(=O)=O

Synonyms:

• Methyl 4-hydroxy-3,5-dinitrobenzoate

Methyl 3,5-Dinitro-4-hydroxybenzoate

CAS: 33927-05-8

Methyl 3,5-Dinitro-4-hydroxybenzoate

Purity: 95%

Molecular weight: 242.14g/mol

Ref: 54-OR1004008

Methyl 3,5-dinitro-4-hydroxybenzoate

CAS: 33927-05-8

Methyl 3,5-dinitro-4-hydroxybenzoate is a reactive compound that can be used to glycosylates alcohols. It is a good choice for the glycosylation of complex oligosaccharides due to its high yields and stereoselectivity. Methyl 3,5-dinitro-4-hydroxybenzoate is an efficient method for the synthesis of oligosaccharides. Reaction with methanol and glycosyl acceptor yields a disaccharide in which the two sugars are linked by an alpha-(1,2) glycosidic bond. The nucleophilic nature of methyl 3,5-dinitro-4-hydroxybenzoate allows it to act as a nucleophile in the reaction with the glycosyl acceptor.

Formula: C₈H₆N₂O₇

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 242.14 g/mol

Ref: 3D-FM70956