CymitQuimica logo

CAS 339274-34-9

:

(αS)-α-Amino-2-bromobenzeneacetic acid

Description:
(αS)-α-Amino-2-bromobenzeneacetic acid, with the CAS number 339274-34-9, is an amino acid derivative characterized by the presence of a bromine atom on the aromatic ring and an amino group adjacent to a carboxylic acid functional group. This compound exhibits both hydrophilic and hydrophobic properties due to its polar amino and carboxylic acid groups, as well as the non-polar bromobenzene moiety. It is typically a white to off-white solid at room temperature and is soluble in polar solvents like water and alcohols, making it suitable for various biochemical applications. The presence of the bromine atom can influence its reactivity and interactions in biological systems, potentially affecting its role in drug design or as a biochemical probe. Additionally, the specific stereochemistry indicated by the (αS) designation suggests that it has a particular spatial arrangement, which can be crucial for its biological activity and interactions with enzymes or receptors. Overall, this compound is of interest in medicinal chemistry and research involving amino acid analogs.
Formula:C8H8BrNO2
InChI:InChI=1S/C8H8BrNO2/c9-6-4-2-1-3-5(6)7(10)8(11)12/h1-4,7H,10H2,(H,11,12)/t7-/m0/s1
InChI key:InChIKey=PTWAPNNQAOAJDI-ZETCQYMHSA-N
SMILES:[C@H](C(O)=O)(N)C1=C(Br)C=CC=C1
Synonyms:
  • (αS)-α-Amino-2-bromobenzeneacetic acid
  • (2S)-2-Amino-2-(2-bromophenyl)acetic acid
  • Benzeneacetic acid, α-amino-2-bromo-, (αS)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.