
CAS 339293-67-3
:(2S,2′S,5S,5aR,9aS,10S)-5a,6,7,9a-Tetrahydro-5,5a,8-trimethylspiro[2,5-methano-1-benzoxepin-4(5H),2′-oxirane]-2,10(3H)-diol
Description:
The chemical substance with the name "(2S,2′S,5S,5aR,9aS,10S)-5a,6,7,9a-Tetrahydro-5,5a,8-trimethylspiro[2,5-methano-1-benzoxepin-4(5H),2′-oxirane]-2,10(3H)-diol" and CAS number "339293-67-3" is a complex organic compound characterized by its unique spirocyclic structure, which includes a benzoxepin moiety and an oxirane ring. This compound features multiple stereocenters, contributing to its chiral nature, which can influence its biological activity and interactions. The presence of hydroxyl groups indicates potential for hydrogen bonding, which may enhance solubility in polar solvents and affect its reactivity. The trimethyl groups suggest a degree of steric hindrance, which can impact the compound's conformation and stability. Overall, this substance may exhibit interesting pharmacological properties, making it a candidate for further research in medicinal chemistry and related fields. Its intricate structure and stereochemistry are essential for understanding its potential applications and behavior in various chemical environments.
Formula:C15H22O4
InChI:InChI=1S/C15H22O4/c1-9-4-5-12(2)10(6-9)19-15(17)7-14(8-18-14)13(12,3)11(15)16/h6,10-11,16-17H,4-5,7-8H2,1-3H3/t10-,11-,12-,13+,14+,15-/m0/s1
InChI key:InChIKey=SSTQGEBHEZQSQQ-VMCMIOBHSA-N
SMILES:C[C@@]12[C@@]3(C[C@@](O)([C@H]1O)O[C@@]4([C@]2(C)CCC(C)=C4)[H])CO3
Synonyms:- (2S,2′S,5S,5aR,9aS,10S)-5a,6,7,9a-Tetrahydro-5,5a,8-trimethylspiro[2,5-methano-1-benzoxepin-4(5H),2′-oxirane]-2,10(3H)-diol
- Spiro[2,5-methano-1-benzoxepin-4(5H),2′-oxirane]-2,10(3H)-diol, 5a,6,7,9a-tetrahydro-5,5a,8-trimethyl-, (2S,2′S,5S,5aR,9aS,10S)-
- Curvularol
- curvularol
- Spiro[2,5-methano-1-benzoxepin-4(5H),2′-oxiran]-2,10(3H)-diol, 5a,6,7,9a-tetrahydro-5,5a,8-trimethyl-, (2S,2′S,5S,5aR,9aS,10S)-
- PubChem ID: 9816788
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Curvularol
CAS:Curvularol exhibits mild antifungal activity but lacks antibacterial effects. At a concentration of 150 ng/mL, it can inhibit the cell cycle progression of normal rat renal cells (G1 phase NRK). Additionally, 100 ng/mL of Curvularol can restore the morphology of deformed NRK cells induced by SRCTS. Curvularol also inhibits protein synthesis.
Formula:C15H22O4Color and Shape:SolidMolecular weight:266.333
