CymitQuimica logo

CAS 33948-20-8

:

10-Bromo-10,11-dihydro-5H-dibenz[b,f]azepine-5-carbonyl chloride

Description:
10-Bromo-10,11-dihydro-5H-dibenz[b,f]azepine-5-carbonyl chloride is a chemical compound characterized by its complex bicyclic structure, which includes a dibenzazepine framework. This compound features a bromine atom at the 10-position and a carbonyl chloride functional group, making it a reactive acyl chloride. The presence of the bromine substituent can influence its reactivity and potential applications in organic synthesis, particularly in the formation of various derivatives through nucleophilic substitution reactions. The carbonyl chloride group is known for its ability to react with amines, alcohols, and other nucleophiles, facilitating the introduction of diverse functional groups. Additionally, the compound's unique structure may impart specific biological activities, making it of interest in medicinal chemistry. Its CAS number, 33948-20-8, allows for easy identification and reference in chemical databases. Overall, this compound exemplifies the intricate relationship between molecular structure and reactivity in organic chemistry.
Formula:C15H11BrClNO
InChI:InChI=1S/C15H11BrClNO/c16-12-9-10-5-1-3-7-13(10)18(15(17)19)14-8-4-2-6-11(12)14/h1-8,12H,9H2
InChI key:InChIKey=VHLSEKYKAQICDS-UHFFFAOYSA-N
SMILES:C(Cl)(=O)N1C=2C(C(Br)CC=3C1=CC=CC3)=CC=CC2
Synonyms:
  • 10-Bromo-10,11-dihydro-dibenzo[b,f]azepine-5-carbonyl chloride
  • 10-Bromo-10,11-dihydro-5H-dibenz[b,f]azepine-5-carbonyl chloride
  • 5H-Dibenz[b,f]azepine-5-carbonyl chloride, 10-bromo-10,11-dihydro-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.