CAS 3395-40-2

[2-(methylsulfanyl)phenoxy]acetic acid

Description:

[2-(Methylsulfanyl)phenoxy]acetic acid, with the CAS number 3395-40-2, is an organic compound characterized by its phenoxyacetic acid structure, which includes a methylsulfanyl group attached to the phenyl ring. This compound typically exhibits properties associated with both phenolic and carboxylic acid functionalities, such as moderate solubility in polar solvents and potential reactivity with bases and nucleophiles. It may display biological activity, making it of interest in various fields, including pharmaceuticals and agrochemicals. The presence of the methylsulfanyl group can influence its chemical reactivity and stability, potentially enhancing its lipophilicity and affecting its interaction with biological systems. Additionally, the compound's structure suggests it may participate in hydrogen bonding due to the carboxylic acid group, which could impact its solubility and interaction with other molecules. Overall, [2-(methylsulfanyl)phenoxy]acetic acid is a compound of interest due to its unique structural features and potential applications in chemical synthesis and biological research.

Formula: C₉H₁₀O₃S

InChI: InChI=1/C9H10O3S/c1-13-8-5-3-2-4-7(8)12-6-9(10)11/h2-5H,6H2,1H3,(H,10,11)

SMILES: CSc1ccccc1OCC(=O)O

Synonyms:

• Acetic acid, 2-[2-(methylthio)phenoxy]-
• [2-(Methylsulfanyl)phenoxy]acetic acid

[2-(Methylthio)phenoxy]acetic Acid

CAS: 3395-40-2

Formula: C₉H₁₀O₃S

Purity: 95%

Color and Shape: Solid

Molecular weight: 198.2389

Ref: IN-DA00C772

[2-(Methylthio)phenoxy]acetic acid

CAS: 3395-40-2

[2-(Methylthio)phenoxy]acetic acid

Purity: ≥95%

Molecular weight: 198.24g/mol

Ref: 54-OR470099

2-(2-(Methylthio)phenoxy)acetic acid

CAS: 3395-40-2

Purity: ≥95%

Molecular weight: 198.2400055

Ref: 10-F773048