CAS 3395-79-7
:1-(dimethoxymethyl)-3-nitrobenzene
Description:
1-(Dimethoxymethyl)-3-nitrobenzene, with the CAS number 3395-79-7, is an organic compound characterized by its nitro group and dimethoxymethyl substituents on a benzene ring. This compound typically appears as a pale yellow to light brown solid or liquid, depending on its purity and specific conditions. It is known for its aromatic properties, which contribute to its stability and reactivity. The presence of the nitro group introduces significant electron-withdrawing characteristics, influencing the compound's reactivity in electrophilic aromatic substitution reactions. The dimethoxymethyl groups enhance its solubility in organic solvents and may also affect its overall polarity. This compound is of interest in various chemical syntheses and may serve as an intermediate in the production of more complex organic molecules. Safety precautions should be observed when handling this substance, as nitro compounds can be hazardous and may pose environmental risks. Proper storage and disposal methods are essential to mitigate any potential hazards associated with its use.
Formula:C9H11NO4
InChI:InChI=1/C9H11NO4/c1-13-9(14-2)7-4-3-5-8(6-7)10(11)12/h3-6,9H,1-2H3
SMILES:COC(c1cccc(c1)N(=O)=O)OC
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
3-Nitrobenzaldehyde dimethyl acetal
CAS:3-Nitrobenzaldehyde dimethyl acetal is a reagent that is used in organic synthesis. It is a white solid that can be dissolved in polar solvents such as ethanol, acetone and water. This compound has been shown to be useful in the preparation of pharmaceuticals and other chemicals. 3-Nitrobenzaldehyde dimethyl acetal has been shown to react with amines, alcohols, carboxylic acids and phenols to produce various compounds. It also reacts with nitric acid to form an explosive compound called nitrophenol.
Formula:C9H11NO4Purity:Min. 95%Color and Shape:Clear LiquidMolecular weight:197.19 g/mol
