CAS 33950-02-6
:1,1-dimethylpiperazin-1-ium chloride
Description:
1,1-Dimethylpiperazin-1-ium chloride is a quaternary ammonium compound characterized by its piperazine backbone, which is substituted with two methyl groups at the nitrogen atom. This compound typically appears as a white to off-white crystalline solid and is soluble in water and various organic solvents, making it versatile for different applications. Its structure contributes to its ionic nature, as it contains a positively charged nitrogen atom and a chloride anion. The presence of the dimethyl substituents enhances its lipophilicity, which can influence its biological activity and interaction with membranes. 1,1-Dimethylpiperazin-1-ium chloride is often used in chemical synthesis, as a phase transfer catalyst, and in various research applications, particularly in the fields of medicinal chemistry and materials science. Additionally, due to its quaternary ammonium nature, it may exhibit antimicrobial properties, making it of interest in biocidal formulations. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance.
Formula:C6H15ClN2
InChI:InChI=1/C6H15N2.ClH/c1-8(2)5-3-7-4-6-8;/h7H,3-6H2,1-2H3;1H/q+1;/p-1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
1,1-Dimethylpiperazin-1-ium chloride
CAS:<p>1,1-Dimethylpiperazin-1-ium chloride is a fine chemical that is used as a building block in the synthesis of complex compounds. It has been shown to be useful as a reaction component in the synthesis of speciality chemicals and intermediate products for research purposes. 1,1-Dimethylpiperazin-1-ium chloride is also an important reagent for the preparation of high quality chemical compounds.</p>Formula:C6H15ClN2Purity:Min. 95%Color and Shape:PowderMolecular weight:150.65 g/mol
