CAS 33963-55-2

2-(Methylsulfonyl)benzoic acid

Description:

2-(Methylsulfonyl)benzoic acid, with the CAS number 33963-55-2, is an organic compound characterized by the presence of a benzoic acid moiety substituted with a methylsulfonyl group at the ortho position. This compound typically appears as a white to off-white solid and is soluble in polar solvents such as water and alcohols due to the presence of the carboxylic acid functional group. The methylsulfonyl group enhances its polarity and may influence its reactivity and biological activity. 2-(Methylsulfonyl)benzoic acid is of interest in various fields, including pharmaceuticals and agrochemicals, due to its potential as an intermediate in the synthesis of other compounds. Its properties may include moderate melting and boiling points, and it may exhibit acidic behavior, allowing it to participate in various chemical reactions, such as esterification or amidation. Safety data should be consulted for handling and usage, as with any chemical substance, to ensure proper precautions are taken.

Formula: C₈H₇O₄S

InChI: InChI=1/C8H8O4S/c1-13(11,12)7-5-3-2-4-6(7)8(9)10/h2-5H,1H3,(H,9,10)/p-1

SMILES: CS(=O)(=O)c1ccccc1C(=O)[O-]

Synonyms:

• Benzoic acid, 2-(methylsulfonyl)-
• 2-(Methylsulfonyl)Benzoate
• 2-Methanesulfonyl-Benzoic Acid

2-(Methylsulfonyl)benzoic acid

CAS: 33963-55-2

Formula: C₈H₈O₄S

Purity: 97%

Color and Shape: Solid

Molecular weight: 200.2117

Ref: IN-DA003F38

2-(Methylsulphonyl)benzoic acid

CAS: 33963-55-2

2-(Methylsulphonyl)benzoic acid

Purity: 95%

Molecular weight: 200.21g/mol

Ref: 54-OR2589

2-(Methylsulfonyl)benzoic acid

CAS: 33963-55-2

Formula: C₈H₈O₄S

Purity: 97%

Color and Shape: Solid

Molecular weight: 200.21

Ref: 10-F023354

2-(Methylsulphonyl)benzoic acid

CAS: 33963-55-2

2-(Methylsulphonyl)benzoic acid (MSBA) is an inhibitor of nitrite reductase and hydrogen sulfide production in wastewater treatment. It has been shown to be effective against a number of bacteria, including typhimurium and pyocyanin-producing Pseudomonas aeruginosa. MSBA inhibits the growth of these bacteria by reacting with the carboxy terminal group on the enzymes involved in nitrite reduction and hydrogen sulfide production. MSBA also inhibits other enzyme activities, such as acetate hydrolysis, which can lead to corrosion of metal surfaces. In theory, MSBA may react with other compounds that contain hydroxyl groups to form a complex that is insoluble in water vapor or organic solvents. This reaction may result in potential interactions between MSBA and other drugs such as phenytoin or warfarin.

Formula: C₈H₈O₄S

Purity: Min. 95%

Molecular weight: 200.21 g/mol

Ref: 3D-IBA96355