
CAS 3397-16-8
:N-Stearoyl-L-glutamic acid
Description:
N-Stearoyl-L-glutamic acid is a derivative of glutamic acid, characterized by the attachment of a stearoyl group, which is a long-chain fatty acid. This compound is typically a white to off-white powder and is soluble in organic solvents but has limited solubility in water, reflecting its amphiphilic nature due to the presence of both hydrophilic (glutamic acid) and hydrophobic (stearoyl) components. It is often used in pharmaceutical formulations and as an emulsifying agent due to its ability to stabilize oil-water mixtures. Additionally, N-stearoyl-L-glutamic acid can play a role in drug delivery systems, enhancing the bioavailability of poorly soluble drugs. Its safety profile is generally favorable, but like many chemical substances, it should be handled with care, following appropriate safety guidelines. The compound's unique structure allows it to interact with biological membranes, making it of interest in various biochemical applications, including potential uses in cosmetic formulations and as a surfactant in industrial processes.
Formula:C23H43NO5
InChI:InChI=1S/C23H43NO5/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-21(25)24-20(23(28)29)18-19-22(26)27/h20H,2-19H2,1H3,(H,24,25)(H,26,27)(H,28,29)/t20-/m0/s1
InChI key:InChIKey=ATFFFUXLAJBBDE-FQEVSTJZSA-N
SMILES:[C@H](NC(CCCCCCCCCCCCCCCCC)=O)(CCC(O)=O)C(O)=O
Synonyms:- L-Glutamic acid, N-(1-oxooctadecyl)-
- Glutamic acid, N-stearoyl-
- N-Stearoylglutamic acid
- Glutamic acid, N-stearoyl-, L-
- N-(1-Oxooctadecyl)-L-glutamic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Glutamic acid, N-stearoyl-
CAS:<p>Glutamic acid, N-stearoyl- is a α-amino acid.</p>Formula:C23H43NO5Color and Shape:SolidMolecular weight:413.59
