CAS 3397-62-4: 1,3,5-Triazine-2,4-diamine, 6-chloro-
Description:1,3,5-Triazine-2,4-diamine, 6-chloro- is an organic compound characterized by its triazine ring structure, which consists of three nitrogen atoms and three carbon atoms. This compound features two amino groups (-NH2) at the 2 and 4 positions and a chlorine atom at the 6 position of the triazine ring. It is typically a white to off-white solid and is soluble in polar solvents. The presence of amino groups makes it a potential candidate for various applications, including as a building block in the synthesis of agrochemicals, pharmaceuticals, and dyes. The chlorine substituent can enhance its reactivity and influence its biological activity. Additionally, this compound may exhibit properties such as antimicrobial or herbicidal activity, depending on its specific interactions within biological systems. Safety data should be consulted for handling and usage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C3H4ClN5
InChI:InChI=1S/C3H4ClN5/c4-1-7-2(5)9-3(6)8-1/h(H4,5,6,7,8,9)
InChI key:InChIKey=FVFVNNKYKYZTJU-UHFFFAOYSA-N
SMILES:ClC=1N=C(N=C(N1)N)N
- Synonyms:
- 6-Chloro-1,3,5-triazine-2,4-diamine
- 1,3,5-Triazine-2,4-diamine, 6-chloro-
- 4,6-Diamino-2-chloro-s-triazine
- 2,4-Diamino-6-chloro-s-triazine
- s-Triazine, 2,4-diamino-6-chloro-
