CAS 33974-42-4
:methoxy(tripropan-2-yl)silane
Description:
Methoxy(tripropan-2-yl)silane, with the CAS number 33974-42-4, is an organosilicon compound characterized by the presence of a silane functional group attached to a methoxy group and a tripropan-2-yl group. This compound typically exhibits properties common to silanes, such as reactivity with moisture, leading to the formation of siloxane bonds. It is generally a colorless to pale yellow liquid with a distinctive odor. The presence of the methoxy group enhances its solubility in organic solvents, while the tripropan-2-yl groups contribute to its hydrophobic characteristics. Methoxy(tripropan-2-yl)silane is often used as a coupling agent or surface modifier in various applications, including coatings, adhesives, and sealants, due to its ability to improve adhesion between organic materials and inorganic substrates. Additionally, it may serve as a precursor in the synthesis of more complex silane derivatives. Proper handling and storage are essential, as it can hydrolyze in the presence of moisture, releasing methanol and forming silanol species.
Formula:C10H24OSi
InChI:InChI=1/C10H24OSi/c1-8(2)12(11-7,9(3)4)10(5)6/h8-10H,1-7H3
SMILES:CC(C)[Si](C(C)C)(C(C)C)OC
Synonyms:- Methyl triisopropylsilyl ether
- Silane, methoxytris(1-methylethyl)-
- Triisopropyl(methoxy) silane
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Triisopropylmethoxysilane
CAS:S17960 - Triisopropylmethoxysilane
Formula:C10H24OSiColor and Shape:Liquid, ClearMolecular weight:188.386
