
CAS 33981-72-5
:N-(3-Carboxy-1-oxopropyl)-L-glutamic acid
Description:
N-(3-Carboxy-1-oxopropyl)-L-glutamic acid, with the CAS number 33981-72-5, is an amino acid derivative that features a glutamic acid backbone modified with a propanoyl group. This compound is characterized by its carboxylic acid functional groups, which contribute to its solubility in water and its potential to participate in various biochemical reactions. The presence of the oxopropyl group suggests that it may play a role in metabolic pathways, possibly acting as an intermediate or a substrate for enzymatic reactions. Its structure allows for interactions with other biomolecules, making it relevant in biochemical studies, particularly in the context of neurotransmission and metabolic regulation. Additionally, the compound may exhibit specific stereochemistry due to the presence of the L-glutamic acid configuration, which can influence its biological activity and interactions. Overall, N-(3-Carboxy-1-oxopropyl)-L-glutamic acid is of interest in both research and potential therapeutic applications, particularly in fields related to neurochemistry and metabolic engineering.
Formula:C9H13NO7
InChI:InChI=1S/C9H13NO7/c11-6(2-4-8(14)15)10-5(9(16)17)1-3-7(12)13/h5H,1-4H2,(H,10,11)(H,12,13)(H,14,15)(H,16,17)/t5-/m0/s1
InChI key:InChIKey=JCNBNOQGFSXOML-YFKPBYRVSA-N
SMILES:[C@H](NC(CCC(O)=O)=O)(CCC(O)=O)C(O)=O
Synonyms:- Glutamic acid, N-(3-carboxypropionyl)-, L-
- N-(3-Carboxy-1-oxopropyl)-L-glutamic acid
- Glutamic acid, N-(3-carboxypropionyl)-
- L-Glutamic acid, N-(3-carboxy-1-oxopropyl)-
- N-Succinyl-L-glutamic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
N(2)-Succinylglutamate
CAS:N(2)-Succinylglutamate is a bioactive chemical.Formula:C9H13NO7Color and Shape:SolidMolecular weight:247.2
