CAS 33985-71-6: 2,3,6,7-Tetrahydro-1H,5H-benzo[ij]quinolizine-9-carboxaldehyde
Description:2,3,6,7-Tetrahydro-1H,5H-benzo[ij]quinolizine-9-carboxaldehyde, with CAS number 33985-71-6, is a heterocyclic organic compound characterized by its complex bicyclic structure. This compound features a quinolizine core, which is a fused bicyclic system containing nitrogen atoms, contributing to its unique chemical properties. It typically appears as a solid or crystalline substance and is known for its potential biological activity, making it of interest in medicinal chemistry. The presence of the aldehyde functional group (-CHO) indicates that it can participate in various chemical reactions, such as oxidation and condensation. Its solubility may vary depending on the solvent, and it is generally sensitive to light and moisture, which can affect its stability. The compound's structure allows for potential interactions with biological targets, making it a candidate for further research in pharmacology and drug development. As with many organic compounds, handling should be done with care, following appropriate safety protocols to mitigate any risks associated with its use.
Formula:C13H15NO
InChI:InChI=1S/C13H15NO/c15-9-10-7-11-3-1-5-14-6-2-4-12(8-10)13(11)14/h7-9H,1-6H2
InChI key:InChIKey=XIIVBURSIWWDEO-UHFFFAOYSA-N
SMILES:O=CC=1C=C2C3=C(C1)CCCN3CCC2
- Synonyms:
- 1,2,3,5,6,7-Hexahydropyrido[3,2,1-ij]quinoline-9-carbaldehyde
- 1H,5H-Benzo[ij]quinolizine-9-carboxaldehyde, 2,3,6,7-tetrahydro-
- 2,3,6,7-Tetrahydro-1H,5H-benzo[ij]quinolizine-9-carboxaldehyde
- 2,3,6,7-tetrahydro-1H,5H-pyrido[3,2,1-ij]quinoline-9-carbaldehyde
- 5H-Benzo(Ij)Quinolizine-9-Carboxaldehyde, 2,3,6,7-Tetrahydro-1
- 9-Formyl-2,3,6,7-tetrahydro-1H,5H-benzo[ij]quinolizine
- 9-Formyljulolidine
- 9-Julolidinal
- 9-Julolidinylcarboxaldehyde
- K0041
- See more synonyms
- NSC 159999
- 9-Julolidinecarboxaldehyde