CAS 33993-24-7

cyclopropanecarboxylic anhydride

Description:

Cyclopropanecarboxylic anhydride, with the CAS number 33993-24-7, is a cyclic anhydride derived from cyclopropanecarboxylic acid. This compound features a three-membered cyclopropane ring, which contributes to its unique reactivity and strain. As an anhydride, it is characterized by the presence of two acyl groups bonded to the same oxygen atom, resulting in a structure that is typically more reactive than its corresponding carboxylic acid. Cyclopropanecarboxylic anhydride is known for its potential applications in organic synthesis, particularly in the formation of various derivatives and in polymer chemistry. It may exhibit properties such as being a colorless to pale yellow liquid with a pungent odor, and it is likely to be sensitive to moisture, which can lead to hydrolysis and the formation of the corresponding carboxylic acid. Safety precautions should be taken when handling this compound, as it may be irritant to skin and mucous membranes. Overall, its unique structure and reactivity make it a valuable intermediate in chemical synthesis.

Formula: C₈H₁₀O₃

InChI: InChI=1/C8H10O3/c9-7(5-1-2-5)11-8(10)6-3-4-6/h5-6H,1-4H2

SMILES: C1CC1C(=O)OC(=O)C1CC1

Cyclopropanecarboxylic acid, anhydride

CAS: 33993-24-7

Formula: C₈H₁₀O₃

Purity: 90%

Color and Shape: Liquid

Molecular weight: 154.1632

Ref: IN-DA00I6PS

Cyclopropanecarboxylic acid anhydride

CAS: 33993-24-7

Cyclopropanecarboxylic acid anhydride

Purity: 95%

Color and Shape: Liquid

Molecular weight: 154.16g/mol

Ref: 54-OR52359

Cyclopropanecarboxylic acid anhydride

CAS: 33993-24-7

Purity: 90.0%

Color and Shape: Liquid, Clear

Molecular weight: 154.1649932861328

Ref: 10-F038356