CAS 340-05-6: 2,2,2-Trifluoro-1-phenylethanol
Description:2,2,2-Trifluoro-1-phenylethanol is an organic compound characterized by the presence of a trifluoromethyl group and a phenyl group attached to a central carbon atom bearing a hydroxyl (-OH) functional group. This compound typically appears as a colorless to pale yellow liquid with a distinctive odor. It is known for its high polarity due to the electronegative fluorine atoms, which can influence its solubility in various solvents, making it more soluble in polar solvents compared to nonpolar ones. The trifluoromethyl group imparts unique chemical properties, including increased stability and potential applications in pharmaceuticals and agrochemicals. Additionally, 2,2,2-Trifluoro-1-phenylethanol can participate in various chemical reactions, such as nucleophilic substitutions and reductions, making it a valuable intermediate in organic synthesis. Safety considerations include handling it with care due to potential toxicity and environmental impact, as well as ensuring proper ventilation during use.
Formula:C8H7F3O
InChI:InChI=1S/C8H7F3O/c9-8(10,11)7(12)6-4-2-1-3-5-6/h1-5,7,12H
InChI key:InChIKey=VNOMEAQPOMDWSR-UHFFFAOYSA-N
SMILES:FC(F)(F)C(O)C=1C=CC=CC1
- Synonyms:
- (±)-1-Phenyl-2-trifluoroethanol
- (±)-2,2,2-Trifluoro-1-phenylethanol
- (±)-α-(Trifluoromethyl) benzyl alcohol
- 2,2,2-Trifluoro-1-phenylethan-1-ol
- 2,2,2-Trifluorophenylethanol
- Benzenemethanol, α-(trifluoromethyl)-
- Benzyl alcohol, α-(trifluoromethyl)-
- NSC 20214
- alpha-(Trifluoromethyl)benzyl alcohol
- α-(Trifluoromethyl)benzenemethanol
- See more synonyms
- β,β,β-Trifluoro-α-hydroxyethylbenzene

α-(Trifluoromethyl)benzyl Alcohol
Ref: 3B-T1792
5g | 142.00 € | ||
25g | 481.00 € |

2,2,2-Trifluoro-1-phenylethanol
Ref: IN-DA003ELY
1g | 56.00 € | ||
5g | 122.00 € | ||
25g | 328.00 € |

α-(Trifluoromethyl)benzyl alcohol
Ref: 54-PC6224
1g | 40.00 € | ||
5g | 86.00 € |

1-Phenyl-2,2,2-trifluoroethanol
Ref: 10-F002360
1g | To inquire | ||
5g | To inquire | ||
25g | To inquire |

1-Phenyl-2,2,2-Trifluoroethanol
Ref: 3D-FP79861
1g | Discontinued | Request information | |
2g | Discontinued | Request information | |
5g | Discontinued | Request information | |
10g | Discontinued | Request information | |
500mg | Discontinued | Request information |