CAS 3400-33-7

N-methylnaphthalene-1-carboxamide

Description:

N-methylnaphthalene-1-carboxamide, with the CAS number 3400-33-7, is an organic compound characterized by its naphthalene structure substituted with a methyl group and a carboxamide functional group. This compound typically appears as a solid at room temperature and is known for its aromatic properties due to the presence of the naphthalene ring. It is generally insoluble in water but may dissolve in organic solvents such as ethanol and acetone. The presence of the carboxamide group contributes to its potential as a polar compound, influencing its reactivity and interactions in various chemical environments. N-methylnaphthalene-1-carboxamide may exhibit biological activity, making it of interest in medicinal chemistry and materials science. Its synthesis often involves the reaction of naphthalene derivatives with amines and carboxylic acids, highlighting its relevance in organic synthesis. As with many organic compounds, safety precautions should be taken when handling this substance, as it may pose health risks if ingested or inhaled.

Formula: C₁₂H₁₁NO

InChI: InChI=1/C12H11NO/c1-13-12(14)11-8-4-6-9-5-2-3-7-10(9)11/h2-8H,1H3,(H,13,14)

SMILES: CN=C(c1cccc2ccccc12)O

Synonyms:

• 1-Naphthalenecarboxamide, N-methyl-

N-Methyl-1-naphthalenecarboxamide

CAS: 3400-33-7

N-Methyl-1-naphthalenecarboxamide

Purity: 95%

Molecular weight: 185.22g/mol

Ref: 54-OR923941

N-METHYL-1-NAPHTHALENECARBOXAMIDE

CAS: 3400-33-7

Formula: C₁₂H₁₁NO

Purity: 95.0%

Molecular weight: 185.226

Ref: 10-F502239