CAS 3400-45-1
:Cyclopentanecarboxylic acid
Description:
Cyclopentanecarboxylic acid is a cyclic carboxylic acid characterized by a five-membered cyclopentane ring with a carboxyl functional group (-COOH) attached to it. This compound typically appears as a colorless to pale yellow liquid or solid, depending on the temperature. It has a molecular formula of C6H10O2 and features a relatively low boiling point compared to larger carboxylic acids, reflecting its smaller molecular size. Cyclopentanecarboxylic acid is known for its moderate solubility in water, which is influenced by the presence of the polar carboxyl group, while it is more soluble in organic solvents. The compound exhibits typical acid properties, including the ability to donate protons in solution. It can participate in various chemical reactions, such as esterification and decarboxylation, making it useful in organic synthesis. Additionally, cyclopentanecarboxylic acid can serve as a building block in the synthesis of more complex molecules and has potential applications in pharmaceuticals and agrochemicals.
Formula:C6H10O2
InChI:InChI=1S/C6H10O2/c7-6(8)5-3-1-2-4-5/h5H,1-4H2,(H,7,8)
InChI key:InChIKey=JBDSSBMEKXHSJF-UHFFFAOYSA-N
SMILES:C(O)(=O)C1CCCC1
Synonyms:- Cyclopentancarboxylic Acid
- Cyclopentane carboxylic acid
- Cyclopentanecarboxylate
- Cyclopentanoic acid
- Cyclopentylcarboxylic acid
- NSC 59714
- Cyclopentanecarboxylic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
Cyclopentanecarboxylic Acid
CAS:Formula:C6H10O2Purity:>98.0%(GC)(T)Color and Shape:Colorless to Light yellow to Light orange clear liquidMolecular weight:114.14Cyclopentanecarboxylic acid
CAS:Formula:C6H10O2Purity:98%Color and Shape:LiquidMolecular weight:114.1424Cyclopentanecarboxylic acid
CAS:Cyclopentanecarboxylic acidFormula:C6H10O2Purity:98%Color and Shape: colourless liquidMolecular weight:114.14g/molCyclopentanecarboxylic acid
CAS:Formula:C6H10O2Purity:97%Color and Shape:Liquid, ClearMolecular weight:114.144Cyclopentanecarboxylic Acid
CAS:Controlled ProductApplications Cyclopentanecarboxylic Acid is an aliphatic cycloalkyl carboxylic acid used in the preparation of amino acids and other biologically active compounds. Cyclopentanecarboxylic Acid was shown to have plant growth regulating activity.
References Dimitrova, T. et al.: Dok. Bulg. Akad. Nauk., 50, 103 (1997); Hasegawa, M. et al.: Tetrahedron, 56, 10153 (2000);Formula:C6H10O2Color and Shape:NeatMolecular weight:114.14Cyclopentanecarboxylic acid, 99%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci
Formula:C6H10O2Purity:99%Color and Shape:Liquid, Clear colorless to pale yellowMolecular weight:114.14






