CAS 340025-20-9

3-[benzyl(methylsulfonyl)amino]propanoate

Description:

3-[Benzyl(methylsulfonyl)amino]propanoate, with the CAS number 340025-20-9, is a chemical compound characterized by its unique structure that includes a propanoate moiety linked to a benzyl group and a methylsulfonyl functional group. This compound typically exhibits properties associated with both amines and esters, which can influence its solubility, reactivity, and biological activity. The presence of the methylsulfonyl group may enhance its polarity, potentially affecting its interaction with biological systems and its pharmacokinetic properties. Additionally, the benzyl group can contribute to the compound's hydrophobic characteristics, which may influence its ability to permeate biological membranes. The compound's synthesis and applications may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to the potential biological activities associated with sulfonamide derivatives. Overall, 3-[benzyl(methylsulfonyl)amino]propanoate represents a versatile structure that may serve as a valuable scaffold in drug design and development.

Formula: C₁₁H₁₄NO₄S

InChI: InChI=1/C11H15NO4S/c1-17(15,16)12(8-7-11(13)14)9-10-5-3-2-4-6-10/h2-6H,7-9H2,1H3,(H,13,14)/p-1

SMILES: CS(=O)(=O)N(CCC(=O)[O-])Cc1ccccc1

3-(N-Benzylmethanesulfonamido)propanoic acid

CAS: 340025-20-9

Versatile small molecule scaffold

Formula: C₁₁H₁₅NO₄S

Purity: Min. 95%

Molecular weight: 257.31 g/mol

Ref: 3D-QNA02520