CAS 3401-80-7
:3,6-Dichlorosalicylic acid
Description:
3,6-Dichlorosalicylic acid is an organic compound characterized by the presence of two chlorine atoms and a carboxylic acid group attached to a salicylic acid backbone. Its molecular structure features a benzene ring with hydroxyl (-OH) and carboxylic acid (-COOH) functional groups, which contribute to its acidic properties. The chlorine substituents are located at the 3 and 6 positions of the aromatic ring, influencing the compound's reactivity and solubility. This compound is typically a white to off-white crystalline solid and is soluble in polar solvents such as water and alcohols, while being less soluble in non-polar solvents. 3,6-Dichlorosalicylic acid is often used in various chemical syntheses and research applications, particularly in the fields of pharmaceuticals and agrochemicals. Its chlorinated structure may impart unique biological activities, making it of interest for further studies in medicinal chemistry. As with many chlorinated compounds, it is essential to handle it with care due to potential environmental and health impacts.
Formula:C7H4Cl2O3
InChI:InChI=1S/C7H4Cl2O3/c8-3-1-2-4(9)6(10)5(3)7(11)12/h1-2,10H,(H,11,12)
InChI key:InChIKey=FKIKPQHMWFZFEB-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C(O)C(Cl)=CC=C1Cl
Synonyms:- 2-Hydroxy-3,6-dichlorobenzoic acid
- 3,6-Dcsa
- 3,6-Dichloro-2-Hydroxy Benzoic Acid
- 3,6-Dichlorosalicylic Acid
- Benzoic acid, 3,6-dichloro-2-hydroxy-
- Salicylic acid, 3,6-dichloro-
- 3,6-Dichloro-2-hydroxybenzoic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
3,6-Dichloro-2-hydroxybenzoic acid
CAS:Formula:C7H4Cl2O3Purity:95%Color and Shape:SolidMolecular weight:207.01093,6-Dichloro-2-hydroxybenzoic acid
CAS:3,6-Dichloro-2-hydroxybenzoic acidPurity:≥95%Molecular weight:207.01g/molDicamba-desmethyl 100 µg/mL in Acetonitrile
CAS:Controlled ProductFormula:C7H4Cl2O3Color and Shape:Single SolutionMolecular weight:207.013,6-Dichloro-2-hydroxybenzoic Acid
CAS:Applications 3,6-Dichloro-2-hydroxybenzoic acid (cas# 3401-80-7) is a useful research chemical.
Formula:C7H4Cl2O3Color and Shape:NeatMolecular weight:207.013,6-Dichloro-2-hydroxy benzoic acid
CAS:3,6-Dichloro-2-hydroxy benzoic acid is a reactive compound that is used as an intermediate in the synthesis of organic compounds. It reacts with the chlorine atom to form a diazonium salt. The diazonium salt then undergoes demethylation, which allows it to be converted into various products such as 3,5-dichloro-2-hydroxybenzoic acid or 2,4-dichloro-3,5-dimethoxybenzoic acid. 3,6-Dichloro-2-hydroxy benzoic acid is a strong base and can react with any acidic compounds present in the reaction vessel. This product has been shown to be effective for wastewater treatment by converting organic compounds into less harmful compounds.Formula:C7H4Cl2O3Purity:Min. 95%Color and Shape:PowderMolecular weight:207.01 g/mol3,6-Dichloro-2-hydroxybenzoic acid
CAS:Formula:C7H4Cl2O3Purity:95.0%Color and Shape:SolidMolecular weight:207.01





