CAS 340179-96-6
:1-(Triphenylmethyl)-1H-imidazole-4-carbonitrile
Description:
1-(Triphenylmethyl)-1H-imidazole-4-carbonitrile, with the CAS number 340179-96-6, is a chemical compound characterized by its imidazole core, which is a five-membered heterocyclic ring containing two nitrogen atoms. This compound features a triphenylmethyl group, which contributes to its stability and lipophilicity, making it potentially useful in various applications, including pharmaceuticals and organic synthesis. The presence of a cyano group (-C≡N) at the 4-position of the imidazole ring enhances its reactivity and can facilitate further chemical modifications. The compound is typically solid at room temperature and may exhibit specific solubility characteristics depending on the solvent used. Its unique structure allows for potential interactions with biological targets, making it of interest in medicinal chemistry. Additionally, the triphenylmethyl moiety can influence the compound's electronic properties, potentially affecting its behavior in chemical reactions and interactions with other molecules. Overall, this compound represents a versatile scaffold for further exploration in chemical research and development.
Formula:C23H17N3
InChI:InChI=1S/C23H17N3/c24-16-22-17-26(18-25-22)23(19-10-4-1-5-11-19,20-12-6-2-7-13-20)21-14-8-3-9-15-21/h1-15,17-18H
InChI key:InChIKey=FSPZKQBDPWCVGG-UHFFFAOYSA-N
SMILES:C(N1C=C(C#N)N=C1)(C2=CC=CC=C2)(C3=CC=CC=C3)C4=CC=CC=C4
Synonyms:- 1H-Imidazole-4-carbonitrile, 1-(triphenylmethyl)-
- 1-(Triphenylmethyl)-1H-imidazole-4-carbonitrile
- 1-Trityl-1H-imidazole-4-carbonitrile
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
1-(Triphenylmethyl)-1H-imidazole-4-carbonitrile
CAS:Controlled ProductFormula:C23H17N3Color and Shape:NeatMolecular weight:335.401
