CymitQuimica logo

CAS 340187-12-4

:

9H-fluoren-9-ylmethyl (2-bromoethyl)carbamate

Description:
9H-fluoren-9-ylmethyl (2-bromoethyl)carbamate is a chemical compound characterized by its unique structure, which includes a fluorenyl group, a carbamate functional group, and a bromoethyl substituent. This compound typically appears as a solid and is soluble in organic solvents, reflecting its hydrophobic fluorenyl moiety. The presence of the bromoethyl group suggests potential reactivity, particularly in nucleophilic substitution reactions, making it useful in organic synthesis and medicinal chemistry. The carbamate functional group can also participate in various chemical reactions, including hydrolysis and transesterification. Additionally, this compound may exhibit biological activity, which can be explored in pharmacological studies. Its specific properties, such as melting point, boiling point, and spectral characteristics, would depend on the purity and specific conditions under which it is studied. Overall, 9H-fluoren-9-ylmethyl (2-bromoethyl)carbamate is a versatile compound with applications in synthetic organic chemistry and potential implications in drug development.
Formula:C17H16BrNO2
InChI:InChI=1/C17H16BrNO2/c18-9-10-19-17(20)21-11-16-14-7-3-1-5-12(14)13-6-2-4-8-15(13)16/h1-8,16H,9-11H2,(H,19,20)
InChI key:GDIPNIOJNLDDRP-UHFFFAOYSA-N
SMILES:c1ccc2c(c1)c1ccccc1C2COC(=NCCBr)O
Synonyms:
  • Carbamic acid, N-(2-bromoethyl)-, 9H-fluoren-9-ylmethyl ester
  • 2-(Fmoc-Amino)Ethyl Bromide
Found 4 products.