CAS 34020-07-0
:(16xi,17R,19E)-1,2-didehydro-2,7-dihydro-7,17-cyclosarpagan-17-yl acetate
Description:
The chemical substance known as "(16xi,17R,19E)-1,2-didehydro-2,7-dihydro-7,17-cyclosarpagan-17-yl acetate," with the CAS number 34020-07-0, is a complex organic compound characterized by its unique structural features. It belongs to a class of compounds known as alkaloids, which are often derived from plant sources and exhibit a variety of biological activities. This particular compound features a cyclosarpagan framework, which includes multiple rings and functional groups that contribute to its chemical reactivity and potential pharmacological properties. The presence of the acetate group suggests that it may participate in esterification reactions, influencing its solubility and reactivity. Additionally, the stereochemistry indicated by the specific nomenclature suggests that the compound has defined spatial arrangements of its atoms, which can significantly affect its biological interactions and activity. Overall, this compound's intricate structure and functional groups make it a subject of interest in medicinal chemistry and natural product research.
Formula:C21H22N2O2
InChI:InChI=1/C21H22N2O2/c1-3-12-10-23-16-8-13(12)18-17(23)9-21(20(18)25-11(2)24)14-6-4-5-7-15(14)22-19(16)21/h3-7,13,16-18,20H,8-10H2,1-2H3/b12-3-/t13?,16-,17-,18?,20+,21?/m0/s1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Vinorine
CAS:Vinorine is a precursor to ajmaline, a monoterpenoid alkaloid antiarrhythmic from Rauvolfia serpentina.Formula:C21H22N2O2Purity:98%Color and Shape:SolidMolecular weight:334.41921-Deoxyvomilenine
CAS:21-Deoxyvomilenine is an indole alkaloid precursor, which is a naturally occurring compound found in specific plant species, particularly within the Apocynaceae family. This compound plays a critical role in the biosynthetic pathway of complex alkaloids. Its source is typically plant-based, emerging during the metabolic processes that convert simpler molecules into complex alkaloidal structures.
Formula:C21H22N2O2Purity:Min. 95%Color and Shape:PowderMolecular weight:334.4 g/mol




