CAS 340216-56-0

2-Bromo-4-[(2,4-dichlorophenyl)methoxy]-5-methoxybenzaldehyde

Description:

2-Bromo-4-[(2,4-dichlorophenyl)methoxy]-5-methoxybenzaldehyde is an organic compound characterized by its complex structure, which includes a bromine atom, multiple methoxy groups, and a benzaldehyde functional group. This compound features a brominated aromatic ring, which can influence its reactivity and solubility. The presence of methoxy groups enhances its electron-donating properties, potentially affecting its chemical behavior in reactions such as electrophilic substitution. The dichlorophenyl moiety introduces additional halogen substituents, which can further modify the compound's physical and chemical properties, including its polarity and biological activity. Typically, compounds like this may exhibit interesting pharmacological properties, making them of interest in medicinal chemistry. The molecular structure suggests potential applications in organic synthesis and as intermediates in the development of pharmaceuticals or agrochemicals. Safety and handling considerations are essential due to the presence of halogens and the aldehyde functional group, which can be reactive and may pose health risks if not managed properly.

Formula: C₁₅H₁₁BrCl₂O₃

InChI: InChI=1S/C15H11BrCl2O3/c1-20-14-4-10(7-19)12(16)6-15(14)21-8-9-2-3-11(17)5-13(9)18/h2-7H,8H2,1H3

InChI key: InChIKey=KOOOEVHEAMOMJO-UHFFFAOYSA-N

SMILES: O(CC1=C(Cl)C=C(Cl)C=C1)C2=C(OC)C=C(C=O)C(Br)=C2

Synonyms:

• 2-Bromo-4-[(2,4-dichlorophenyl)methoxy]-5-methoxybenzaldehyde
• Benzaldehyde, 2-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-methoxy-

2-Bromo-4-[(2,4-dichlorobenzyl)oxy]-5-methoxybenzaldehyde

CAS: 340216-56-0

Versatile small molecule scaffold

Formula: C₁₅H₁₁BrCl₂O₃

Purity: Min. 95%

Molecular weight: 390.1 g/mol

Ref: 3D-QNA21656