CAS 3403-47-2
:5-Amino-2-methoxybenzoic acid
Description:
5-Amino-2-methoxybenzoic acid, with the CAS number 3403-47-2, is an aromatic amino acid derivative characterized by the presence of both an amino group (-NH2) and a methoxy group (-OCH3) attached to a benzoic acid structure. This compound typically appears as a white to off-white crystalline solid and is soluble in polar solvents such as water and alcohols, owing to its functional groups. The amino group contributes to its basicity, while the carboxylic acid group (-COOH) imparts acidic properties, allowing it to participate in various chemical reactions, including amide formation and esterification. Its methoxy group enhances its lipophilicity and can influence its biological activity. 5-Amino-2-methoxybenzoic acid is of interest in pharmaceutical research and organic synthesis, often serving as an intermediate in the production of dyes, pharmaceuticals, and agrochemicals. Additionally, it may exhibit biological activities, making it a subject of study in medicinal chemistry.
Formula:C8H9NO3
InChI:InChI=1S/C8H9NO3/c1-12-7-3-2-5(9)4-6(7)8(10)11/h2-4H,9H2,1H3,(H,10,11)
InChI key:InChIKey=LWWPSEIFAKNPKQ-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C(OC)C=CC(N)=C1
Synonyms:- 3-Carboxy-4-methoxyaniline
- 5-Amino-o-anisic acid
- Benzoic Acid, 5-Amino-2-Methoxy-
- o-Anisic acid, 5-amino-
- 5-Amino-2-methoxybenzoic Acid
- 5-Amino-2-methoxybenzoic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
5-Amino-2-methoxybenzoic Acid
CAS:Formula:C8H9NO3Purity:>97.0%(T)Color and Shape:Light yellow to Brown powder to crystalMolecular weight:167.165-Amino-2-methoxybenzoic acid
CAS:Formula:C8H9NO3Purity:97%Color and Shape:SolidMolecular weight:167.16205-Amino-2-methoxybenzoic acid
CAS:5-Amino-2-methoxybenzoic acidFormula:C8H9NO3Purity:98%Color and Shape: purple solidMolecular weight:167.16g/mol5-Amino-2-methoxybenzoic acid
CAS:5-Amino-2-methoxybenzoic acid (5AMBA) is a hydrogen bond acceptor that binds to peptides and rna. It also has enzymatic activity, which can be used in the treatment of diseases such as Alzheimer's disease. 5AMBA is a small molecule that contains two methoxy groups and one hydrogen. It has been shown to bind to an intramolecular hydrogen bond within a peptide or rna sequence and inhibit enzymatic activity. This inhibition occurs by removing the nucleophile from the enzyme's active site or by sterically hindering access to the enzyme's active site. The luminescent properties of 5AMBA make it an ideal candidate for fluorescent labeling, with applications in biomolecular research.
Formula:C8H9NO3Purity:Min. 95%Color and Shape:PowderMolecular weight:167.16 g/mol5-amino-2-methoxybenzoic acid
CAS:Formula:C8H9NO3Purity:97%Color and Shape:SolidMolecular weight:167.164





