CAS 34035-03-5

5-(4-chlorophenyl)furfural

Description:

5-(4-Chlorophenyl)furfural is an organic compound characterized by its furan and aldehyde functional groups, specifically featuring a chlorophenyl substituent at the 5-position of the furan ring. This compound typically appears as a pale yellow to light brown solid or liquid, depending on its purity and form. It is known for its aromatic properties due to the presence of the chlorophenyl group, which can influence its reactivity and interactions in various chemical environments. The compound is soluble in organic solvents, such as ethanol and dichloromethane, but has limited solubility in water. 5-(4-Chlorophenyl)furfural can be synthesized through various methods, often involving the reaction of furfural with chlorinated aromatic compounds. It has potential applications in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals, due to its ability to serve as an intermediate in the formation of more complex molecules. As with many organic compounds, handling should be done with care, considering potential toxicity and environmental impact.

Formula: C₁₁H₇ClO₂

InChI: InChI=1/C11H7ClO2/c12-9-3-1-8(2-4-9)11-6-5-10(7-13)14-11/h1-7H

SMILES: c1cc(ccc1c1ccc(C=O)o1)Cl

Synonyms:

• 5-(4-Chlorophenyl)Furan-2-Carbaldehyde

5-(4-Chlorophenyl)furfural

CAS: 34035-03-5

Formula: C₁₁H₇ClO₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 206.6251

Ref: IN-DA00345T

5-(4-Chlorophenyl)-2-furaldehyde

CAS: 34035-03-5

Formula: C₁₁H₇ClO₂

Purity: >98.0%(GC)

Color and Shape: White to Light yellow to Light orange powder to crystal

Molecular weight: 206.63

Ref: 3B-C3388

5-(4-Chlorophenyl)-2-furaldehyde

CAS: 34035-03-5

5-(4-Chlorophenyl)-2-furaldehyde

Purity: 97%

Molecular weight: 206.62508g/mol

Ref: 54-OR22530

5-(4-Chlorophenyl)-2-furaldehyde

CAS: 34035-03-5

5-(4-Chlorophenyl)-2-furaldehyde (5-CPFA) is an antitubercular drug that inhibits the growth of tuberculosis bacteria by disrupting the synthesis of DNA. It is a functional theory that 5-CPFA inhibits the bacterial enzyme, chalcone hydroxylase, which is involved in the conversion of chalcones to flavones. This inhibition prevents the formation of reactive oxygen species and leads to cell death. The mechanism of action for 5-CPFA has been shown to be due to its ability to form covalent bonds with metal ions such as copper, zinc, and iron. When exposed to ultraviolet radiation, this compound reacts with these metal ions and causes bond cleavage in DNA strands. The resulting damage in DNA strands leads to cell death within hours.

Formula: C₁₁H₇ClO₂

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 206.62 g/mol

Ref: 3D-FC131390

2-FORMYL-5-(4-CHLOROPHENYL)FURAN

CAS: 34035-03-5

Formula: C₁₁H₇ClO₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 206.63

Ref: 10-F303088