CAS 3404-62-4
:5-Methyl-2-hexene
Description:
5-Methyl-2-hexene is an organic compound classified as an alkene, characterized by the presence of a carbon-carbon double bond in its structure. It has a molecular formula of C7H14, indicating it consists of seven carbon atoms and fourteen hydrogen atoms. This compound is a colorless liquid at room temperature and is known for its distinctive odor. As an unsaturated hydrocarbon, 5-methyl-2-hexene exhibits typical alkene reactivity, including addition reactions with halogens, hydrogen halides, and water, which can lead to the formation of various derivatives. Its structure features a branched chain, which can influence its physical properties, such as boiling point and solubility. 5-Methyl-2-hexene is used in organic synthesis and may serve as an intermediate in the production of other chemicals. Additionally, it is important to handle this compound with care, as it may pose health risks if inhaled or ingested, and appropriate safety measures should be taken during its use in laboratory or industrial settings.
Formula:C7H14
InChI:InChI=1S/C7H14/c1-4-5-6-7(2)3/h4-5,7H,6H2,1-3H3
InChI key:InChIKey=GHBKCPRDHLITSE-UHFFFAOYSA-N
SMILES:C(C(C)C)C=CC
Synonyms:- 2-Hexene, 5-methyl-
- 5-Methyl-2-hexene
- (2E)-5-methylhex-2-ene
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
