CAS 34040-64-7
:Methyl 4-(chloromethyl)benzoate
Description:
Methyl 4-(chloromethyl)benzoate, with the CAS number 34040-64-7, is an organic compound that belongs to the class of benzoate esters. It features a methyl ester functional group attached to a benzoic acid derivative, specifically with a chloromethyl group at the para position of the aromatic ring. This compound is typically a colorless to pale yellow liquid with a characteristic odor. It is soluble in organic solvents such as ethanol and ether but has limited solubility in water due to its hydrophobic aromatic structure. Methyl 4-(chloromethyl)benzoate is often used in organic synthesis as an intermediate for the preparation of various pharmaceuticals and agrochemicals. Its chloromethyl group makes it a reactive species, allowing for further chemical modifications, such as nucleophilic substitutions. Safety precautions should be taken when handling this compound, as it may pose health risks, including irritation to the skin and eyes, and potential toxicity if ingested or inhaled. Proper storage and handling in a well-ventilated area are recommended.
Formula:C9H9ClO2
InChI:InChI=1S/C9H9ClO2/c1-12-9(11)8-4-2-7(6-10)3-5-8/h2-5H,6H2,1H3
InChI key:InChIKey=SATDLKYRVXFXRE-UHFFFAOYSA-N
SMILES:C(OC)(=O)C1=CC=C(CCl)C=C1
Synonyms:- 4-(Chloromethyl)benzoic acid methyl ester
- 4-Methoxycarbonylbenzyl chloride
- Benzoic acid, 4-(chloromethyl)-, methyl ester
- Methyl p-(chloromethyl)benzoate
- Methyl α-chloro-p-toluate
- p-(Methoxycarbonyl)benzyl chloride
- p-Carbomethoxybenzyl chloride
- p-Toluic acid, α-chloro-, methyl ester
- Methyl 4-(chloromethyl)benzoate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Methyl 4-(chloromethyl);benzoate
CAS:Formula:C9H9ClO2Purity:98%Color and Shape:SolidMolecular weight:184.6196Methyl 4-(Chloromethyl)benzoate
CAS:Formula:C9H9ClO2Purity:>98.0%(GC)Color and Shape:White to Light yellow powder to crystalMolecular weight:184.62Methyl 4-(chloromethyl)benzoate
CAS:Methyl 4-(chloromethyl)benzoateFormula:C9H9ClO2Purity:98%Color and Shape: white solidMolecular weight:184.62g/mol4-(Chloromethyl)benzoic acid methyl ester
CAS:4-(Chloromethyl)benzoic acid methyl ester is a synthetic compound that inhibits the DPP-IV enzyme, which is involved in the breakdown of the incretin hormones glucagon-like peptide-1 (GLP-1) and glucose-dependent insulinotropic polypeptide (GIP). Its structure consists of a benzene ring with a chloromethyl group on one side and an ester group on the other. 4-(Chloromethyl)benzoic acid methyl ester has been shown to be more potent than other known DPP-IV inhibitors. It has also been shown to have genotoxic impurities and chronic treatment effects, such as cancer.
Formula:C9H9ClO2Purity:Min. 95%Color and Shape:PowderMolecular weight:184.62 g/molMethyl 4-(chloromethyl)benzoate
CAS:Formula:C9H9ClO2Purity:95%Color and Shape:White to slightly pale yellow powderMolecular weight:184.62




