CymitQuimica logo

CAS 34041-09-3

:

Hexanoic acid, 2-ethyl-, molybdenum salt (1:?)

Description:
Hexanoic acid, 2-ethyl-, molybdenum salt (CAS 34041-09-3) is a coordination compound formed from the reaction of 2-ethylhexanoic acid and molybdenum. This substance typically exhibits characteristics associated with metal salts, including solubility in organic solvents and potential applications in catalysis or as a precursor in various chemical processes. The presence of the molybdenum ion can impart unique catalytic properties, making it useful in industrial applications, particularly in the field of organic synthesis and materials science. The 2-ethylhexanoic acid component contributes to the compound's hydrophobic nature, which can influence its behavior in different chemical environments. Additionally, the compound may exhibit stability under certain conditions, but its reactivity can vary based on the presence of other reactants or environmental factors. Safety data should be consulted for handling and storage, as metal salts can pose health risks if not managed properly. Overall, this compound represents a specific intersection of organic and inorganic chemistry with potential utility in various applications.
Formula:C8H16O2·xMo
InChI:InChI=1S/C8H16O2.Mo/c1-3-5-6-7(4-2)8(9)10;/h7H,3-6H2,1-2H3,(H,9,10);
InChI key:InChIKey=VXIWJTFRRIZCQJ-UHFFFAOYSA-N
SMILES:C(CCCC)(C(O)=O)CC.[Mo]
Synonyms:
  • Hexanoic acid, 2-ethyl-, molybdenum salt (1:?)
  • Hexanoic acid, 2-ethyl-, molybdenum salt
  • Molybdenum 2-ethylhexanoate
  • Hexanoate, 2-Ethyl-, Molybdenum Salt (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.