CymitQuimica logo

CAS 34044-00-3

:

2,5-dimethyl-2-(4,8,12-trimethyltridecyl)-2H-benzo[h]chromen-6-ol

Description:
2,5-Dimethyl-2-(4,8,12-trimethyltridecyl)-2H-benzo[h]chromen-6-ol, with the CAS number 34044-00-3, is a complex organic compound characterized by its polycyclic structure, which includes a benzo[h]chromene moiety. This compound features multiple methyl groups, contributing to its hydrophobic nature and potentially influencing its solubility and reactivity. The presence of a hydroxyl group (–OH) indicates that it may exhibit phenolic properties, which can affect its antioxidant activity and interactions with biological systems. The long alkyl chain (4,8,12-trimethyltridecyl) suggests that it may have surfactant-like properties, enhancing its ability to interact with lipid membranes. This compound is likely to be lipophilic, making it suitable for applications in formulations where oil solubility is advantageous. Its structural complexity may also lead to unique optical properties, potentially making it of interest in materials science or photonics. Overall, the characteristics of this compound suggest potential utility in various chemical and industrial applications, although specific behavior would depend on the context of use.
Formula:C31H46O2
InChI:InChI=1/C31H46O2/c1-22(2)12-9-13-23(3)14-10-15-24(4)16-11-20-31(6)21-19-26-25(5)29(32)27-17-7-8-18-28(27)30(26)33-31/h7-8,17-19,21-24,32H,9-16,20H2,1-6H3
SMILES:CC(C)CCCC(C)CCCC(C)CCCC1(C)C=Cc2c(C)c(c3ccccc3c2O1)O
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.