CAS 34050-00-5
:(S)-2,6-Diisocyanatohexanoic acid
Description:
(S)-2,6-Diisocyanatohexanoic acid, with the CAS number 34050-00-5, is a chemical compound characterized by the presence of two isocyanate functional groups (-N=C=O) attached to a hexanoic acid backbone. This compound is typically a solid at room temperature and is known for its reactivity, particularly in forming polyurethanes and other polymers through reactions with alcohols or amines. The presence of the isocyanate groups makes it highly reactive, allowing it to participate in various chemical reactions, including nucleophilic addition and polymerization. The (S) designation indicates that the compound has a specific stereochemistry, which can influence its reactivity and interactions with biological systems. Additionally, due to the isocyanate groups, this compound may pose health hazards, including respiratory irritation and sensitization, necessitating careful handling and appropriate safety measures in laboratory or industrial settings. Overall, (S)-2,6-Diisocyanatohexanoic acid is significant in materials science and polymer chemistry due to its versatile reactivity.
Formula:C8H10N2O4
InChI:InChI=1/C8H10N2O4/c11-5-9-4-2-1-3-7(8(13)14)10-6-12/h7H,1-4H2,(H,13,14)/t7-/m0/s1
SMILES:C(CCN=C=O)C[C@@H](C(=O)O)N=C=O
Synonyms:- methyl N~2~,N~6~-bis(oxomethylidene)lysinate
- N2,N6-bis(oxomethylidene)-L-lysine
- Hexanoic acid, 2,6-diisocyanato-, (2S)-
- L-Lysine diisocyanate
- (S)-2,6-Diisocyanatohexanoic acid
- L-Lysine diisocyanate Methyl ester
- 2,6-DiisocyanatoMethylCaproate
- Methyl Ester L-Lysine Diisocyanate
- 2,6-Diisocyanatohexanoic Acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
L-Lysine diisocyanate
CAS:<p>L-Lysine diisocyanate is an organic compound that is a reactive site for the production of calcium stearate and ethylene diamine. It has been shown to be a reactive site in vitro, but not in vivo. L-Lysine diisocyanate reacts with water vapor to produce hydrogen cyanide, which is toxic to cells. The presence of l-lysine can inhibit the formation of hydrogen cyanide, but it also inhibits uptake into cells and tissue cultures.</p>Formula:C8H10N2O4Purity:Min. 95 Area-%Molecular weight:198.18 g/mol
