CAS 34051-43-9
:[(3S,4R,5S,6R)-5-acetamido-3,4-diacetoxy-6-hydroxy-tetrahydropyran-2-yl]methyl acetate
Description:
The chemical substance with the name "[(3S,4R,5S,6R)-5-acetamido-3,4-diacetoxy-6-hydroxy-tetrahydropyran-2-yl]methyl acetate" and CAS number 34051-43-9 is a complex organic compound characterized by its tetrahydropyran ring structure, which is a six-membered cyclic ether. This compound features multiple functional groups, including acetamido, diacetoxy, and hydroxy groups, contributing to its reactivity and potential biological activity. The stereochemistry indicated by the (3S,4R,5S,6R) configuration suggests specific spatial arrangements of atoms that can influence the compound's interactions in biological systems. It is likely to be soluble in polar solvents due to the presence of hydroxyl and acetamido groups, which can engage in hydrogen bonding. The presence of acetate groups may also impart certain lipophilic characteristics. Such compounds are often of interest in medicinal chemistry and biochemistry, potentially serving as intermediates in the synthesis of pharmaceuticals or as bioactive molecules. Further studies would be necessary to elucidate its specific properties and applications.
Formula:C14H21NO9
InChI:InChI=1/C14H21NO9/c1-6(16)15-11-13(23-9(4)19)12(22-8(3)18)10(24-14(11)20)5-21-7(2)17/h10-14,20H,5H2,1-4H3,(H,15,16)/t10?,11-,12+,13+,14+/m0/s1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
2-Acetamido-3,4,6-tri-O-acetyl-2-deoxy-D-glucopyranose
CAS:<p>2-Acétamido-3,4,6-tri-O-acetyl-2-deoxy-D-glucopyranose is a cytotoxic glycoside that can be used as an intermediate in the synthesis of saponins. It has been shown to yield high yields of trifluoromethanesulfonate (TFM) when reacted with glycosyl acceptors such as albizia bark extract. The TFM may then be used for the synthesis of nitromethane and alcohols. This compound also reacts with oleanolic acid to form an anomeric mixture that can be used to yield 2,3,4,6 tetraacetylated 2 deoxyglucose.</p>Formula:C14H21NO9Purity:Min. 95%Color and Shape:PowderMolecular weight:347.32 g/mol2-(Acetylamino)-2-deoxy-D-glucopyranose 3,4,6-Triacetate
CAS:Controlled Product<p>Applications 2-(Acetylamino)-2-deoxy-D-glucopyranose 3,4,6-Triacetate (cas# 34051-43-9) is a compound useful in organic synthesis.<br></p>Formula:C14H21NO9Color and Shape:NeatMolecular weight:347.32


