CAS 3406-76-6

2-[(4-Bromophenyl)thio]acetic acid

Description:

2-[(4-Bromophenyl)thio]acetic acid, with the CAS number 3406-76-6, is an organic compound characterized by the presence of a thioether functional group and a carboxylic acid. It features a brominated phenyl group attached to a sulfur atom, which is further connected to an acetic acid moiety. This compound typically appears as a solid or crystalline substance and is soluble in polar solvents due to the presence of the carboxylic acid group. The bromine substituent on the phenyl ring can influence its reactivity and biological activity, making it of interest in various chemical and pharmaceutical applications. The thioether linkage may also impart unique properties, such as altered lipophilicity and potential interactions in biological systems. Overall, 2-[(4-Bromophenyl)thio]acetic acid is notable for its structural features that can be leveraged in synthetic chemistry and medicinal research.

Formula: C₈H₇BrO₂S

InChI: InChI=1S/C8H7BrO2S/c9-6-1-3-7(4-2-6)12-5-8(10)11/h1-4H,5H2,(H,10,11)

InChI key: InChIKey=ZREFBQZGAVWLKX-UHFFFAOYSA-N

SMILES: S(CC(O)=O)C1=CC=C(Br)C=C1

Synonyms:

• Acetic acid, [(4-bromophenyl)thio]-
• 2-[(4-Bromophenyl)thio]acetic acid
• Acetic acid, 2-[(4-bromophenyl)thio]-
• (p-Bromophenyl)thioglycolic acid
• Acetic acid, [(p-bromophenyl)thio]-

(4-Bromophenylsulfanyl)acetic acid

CAS: 3406-76-6

Formula: C₈H₇BrO₂S

Molecular weight: 247.1090

Ref: IN-DA00CLON

4-Bromo-phenylthioacetic acid

CAS: 3406-76-6

Formula: C₈H₇BrO₂S

Purity: 98.0%

Color and Shape: Solid

Molecular weight: 247.11

Ref: 10-F033382

(4-Bromo-phenylsulfanyl)-acetic acid

CAS: 3406-76-6

Versatile small molecule scaffold

Formula: C₈H₇BrO₂S

Purity: Min. 95%

Molecular weight: 247.11 g/mol

Ref: 3D-DAA40676