CAS 3406-77-7

[(4-methoxyphenyl)sulfanyl]acetic acid

Description:

[(4-Methoxyphenyl)sulfanyl]acetic acid, with the CAS number 3406-77-7, is an organic compound characterized by the presence of a sulfanyl (thioether) group attached to an acetic acid moiety and a para-methoxyphenyl group. This compound typically appears as a solid or liquid, depending on its purity and environmental conditions. It exhibits moderate solubility in polar solvents due to the presence of the carboxylic acid functional group, which can engage in hydrogen bonding. The methoxy group enhances its lipophilicity, potentially influencing its biological activity and interaction with various biological systems. The sulfanyl group may impart unique reactivity, making it a candidate for various chemical transformations. Additionally, compounds of this nature may exhibit interesting pharmacological properties, including anti-inflammatory or analgesic effects, although specific biological activities would require empirical investigation. Safety data should be consulted, as with any chemical, to understand its handling, toxicity, and environmental impact.

Formula: C₉H₁₀O₃S

InChI: InChI=1/C9H10O3S/c1-12-7-2-4-8(5-3-7)13-6-9(10)11/h2-5H,6H2,1H3,(H,10,11)

SMILES: COc1ccc(cc1)SCC(=O)O

Synonyms:

• Acetic Acid, 2-[(4-Methoxyphenyl)Thio]-
• [(4-Methoxyphenyl)sulfanyl]acetic acid

4-(3-chloropropyl)-4-(4-fluorophenyl)-1,3-dioxolane

CAS: 3406-77-7

Formula: C₉H₁₀O₃S

Purity: 97%

Color and Shape: Solid

Molecular weight: 198.2389

Ref: IN-DA007HL1

2-((4-Methoxyphenyl)thio)acetic acid

CAS: 3406-77-7

2-((4-Methoxyphenyl)thio)acetic acid

Purity: 97%

Molecular weight: 198.24g/mol

Ref: 54-OR1055488

[(4-methoxyphenyl)thio]acetic acid

CAS: 3406-77-7

Formula: C₉H₁₀O₃S

Purity: 95.0%

Molecular weight: 198.24

Ref: 10-F348198

2-((4-Methoxyphenyl)thio)acetic acid

CAS: 3406-77-7

Versatile small molecule scaffold

Formula: C₉H₁₀O₃S

Purity: Min. 95%

Molecular weight: 198.24 g/mol

Ref: 3D-DAA40677