CAS 3407-94-1
:2,6-Acridinediamine
Description:
2,6-Acridinediamine, with the CAS number 3407-94-1, is an organic compound characterized by its acridine backbone, which consists of a fused tricyclic structure containing nitrogen atoms. This compound features two amino groups (-NH2) located at the 2 and 6 positions of the acridine ring, contributing to its reactivity and potential applications in various fields. It is typically a solid at room temperature and may exhibit a range of colors depending on its purity and form. 2,6-Acridinediamine is known for its ability to participate in various chemical reactions, including nucleophilic substitutions and coupling reactions, making it valuable in organic synthesis and materials science. Additionally, it has been studied for its potential biological activities, including antimicrobial and anticancer properties. However, handling this compound requires caution due to its potential toxicity and the need for appropriate safety measures in laboratory settings. Overall, 2,6-Acridinediamine is a versatile compound with significant implications in both chemical research and industrial applications.
Formula:C13H11N3
InChI:InChI=1S/C13H11N3/c14-10-3-4-12-9(6-10)5-8-1-2-11(15)7-13(8)16-12/h1-7H,14-15H2
InChI key:InChIKey=AXNLREBQOMGJMQ-UHFFFAOYSA-N
SMILES:NC1=CC2=C(C=C3C(=N2)C=CC(N)=C3)C=C1
Synonyms:- 2,6-Acridinediamine (9CI)
- Diflavine
- 2,6-acridinediamine
- Acridine, 2,6-diamino-
- 2,6-Acridinediamine
- 2,6-Diaminoacridine
- Diflavine (acridine derivative)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Acridine, 2,6-diamino- (8CI)
CAS:<p>Acridine, 2,6-diamino- (8CI) is a biochemical.</p>Formula:C13H11N3Color and Shape:SolidMolecular weight:209.25
