CAS 340736-76-7

4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]benzoic acid

Description:

4-[5-(Trifluoromethyl)-1,2,4-oxadiazol-3-yl]benzoic acid is a chemical compound characterized by its unique structure, which includes a benzoic acid moiety and a trifluoromethyl-substituted oxadiazole ring. This compound typically exhibits properties such as high thermal stability and potential solubility in organic solvents, making it useful in various chemical applications. The presence of the trifluoromethyl group enhances its lipophilicity and can influence its biological activity, often leading to increased potency in pharmaceutical contexts. The oxadiazole ring contributes to its heterocyclic nature, which can impart specific reactivity and interaction with biological targets. Additionally, the carboxylic acid functional group allows for potential hydrogen bonding and reactivity in various chemical reactions. Overall, this compound is of interest in fields such as medicinal chemistry, agrochemicals, and materials science due to its distinctive structural features and potential applications.

Formula: C₁₀H₅F₃N₂O₃

InChI: InChI=1/C10H5F3N2O3/c11-10(12,13)9-14-7(15-18-9)5-1-3-6(4-2-5)8(16)17/h1-4H,(H,16,17)

SMILES: c1cc(ccc1c1nc(C(F)(F)F)on1)C(=O)O

Synonyms:

• Benzoic Acid, 4-[5-(Trifluoromethyl)-1,2,4-Oxadiazol-3-Yl]-
• 4-(5-(Trifluoromethyl)-1,2,4-oxadiazol-3-yl)benzoicacid
• 4-(5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl)benzoic acid

4-(5-(Trifluoromethyl)-1,2,4-oxadiazol-3-yl)benzoic acid

CAS: 340736-76-7

Formula: C₁₀H₅F₃N₂O₃

Purity: 95%

Color and Shape: Solid

Molecular weight: 258.1535

Ref: IN-DA00382C

4-(5-(Trifluoromethyl)-1,2,4-oxadiazol-3-yl)benzoic acid

CAS: 340736-76-7

4-(5-(Trifluoromethyl)-1,2,4-oxadiazol-3-yl)benzoic acid

Purity: 97%

Molecular weight: 258.16g/mol

Ref: 54-PC99851

4-(5-Trifluoromethyl-1,2,4-oxadiazol-3-yl)-benzoic Acid

Controlled Product

CAS: 340736-76-7

Applications 4-(5-Trifluoromethyl-1,2,4-oxadiazol-3-yl)-benzoic Acid is an intermediate in the synthesis of small molecule inhibitors of HIV-1 gp41.
References Munnaluri, R., et al.: Med. Chem. Res., 24, 829 (2015); Liu, K., et al.: J. Med. Chem., 51, 7843 (2008); Kitamura, S., et al.: Chem. Pharma. Bull., 49, 268 (2001);

Formula: C₁₀H₅F₃N₂O₃

Color and Shape: Neat

Molecular weight: 258.15

Ref: TR-T791530

4-(5-(Trifluoromethyl)-1,2,4-oxadiazol-3-yl)benzoic acid

CAS: 340736-76-7

Formula: C₁₀H₅F₃N₂O₃

Purity: 97%

Color and Shape: Solid

Molecular weight: 258.156

Ref: 10-F223473