CAS 340774-69-8
:Ambuic acid
Description:
Ambuic acid, identified by its CAS number 340774-69-8, is a chemical compound that belongs to the class of organic acids. It is characterized by its unique molecular structure, which includes functional groups that contribute to its acidic properties. Ambuic acid is typically studied for its potential applications in various fields, including pharmaceuticals and biochemistry. Its solubility in water and organic solvents can vary, influencing its reactivity and interactions with other compounds. The substance may exhibit specific biological activities, making it of interest in medicinal chemistry. Additionally, its stability under different environmental conditions is an important factor for its practical applications. As with many organic acids, the presence of carboxylic acid groups in its structure is likely to play a significant role in its chemical behavior, including its ability to donate protons in solution. Overall, Ambuic acid represents a compound with potential utility in research and industry, warranting further investigation into its properties and applications.
Formula:C19H26O6
InChI:InChI=1S/C19H26O6/c1-3-4-5-6-7-8-13-14(11-20)15(21)17-19(25-17,16(13)22)10-9-12(2)18(23)24/h7-9,15,17,20-21H,3-6,10-11H2,1-2H3,(H,23,24)/b8-7+,12-9+/t15-,17-,19+/m1/s1
InChI key:InChIKey=UDSQZJMGPSRCEM-HDKVZZTHSA-N
SMILES:C(/C=C(/C(O)=O)\C)[C@]12[C@](O1)([C@H](O)C(CO)=C(/C=C/CCCCC)C2=O)[H]
Synonyms:- (+)-Ambuic acid
- 2-Butenoic acid, 4-[(1R,5R,6R)-3-(1E)-1-hepten-1-yl-5-hydroxy-4-(hydroxymethyl)-2-oxo-7-oxabicyclo[4.1.0]hept-3-en-1-yl]-2-methyl-, (2E)-
- 2-Butenoic acid, 4-[(1R,5R,6R)-3-(1E)-1-heptenyl-5-hydroxy-4-(hydroxymethyl)-2-oxo-7-oxabicyclo[4.1.0]hept-3-en-1-yl]-2-methyl-, (2E)-
- Ambuic acid
- (2E)-4-[(1R,5R,6R)-3-(1E)-1-Hepten-1-yl-5-hydroxy-4-(hydroxymethyl)-2-oxo-7-oxabicyclo[4.1.0]hept-3-en-1-yl]-2-methyl-2-butenoic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Ambuic acid
CAS:Ambuic acid is a naturally occurring fungal metabolite, which is isolated primarily from various species of the fungal genus *Pestalotiopsis*. It is characterized by its unique capacity to disrupt bacterial communication pathways. The mode of action of ambuic acid involves the inhibition of quorum sensing, a crucial mechanism used by bacteria to coordinate gene expression in response to population density. By impairing this signaling system, ambuic acid effectively reduces the expression of virulence factors in pathogenic bacteria, thereby attenuating their ability to cause disease.Formula:C19H26O6Purity:Min. 95%Molecular weight:350.4 g/molAmbuic acid
CAS:Ambuic acid: cyclohexanone with antifungal, quorum-inhibiting, antibacterial properties, blocks cyclic peptides; reduces MRSA abscesses in mice.Formula:C19H26O6Color and Shape:SolidMolecular weight:350.41




