CAS 34079-68-0
:9-(beta-D-arabinofuranosyl)-9H-purine-2,6-diamine
Description:
9-(β-D-arabinofuranosyl)-9H-purine-2,6-diamine, commonly known as Ara-A or arabinosyladenine, is a nucleoside analog with notable antiviral properties. It is characterized by its purine base structure, specifically adenine, linked to a β-D-arabinofuranosyl sugar moiety. This compound exhibits a unique configuration that enhances its ability to inhibit viral replication, making it particularly effective against certain viruses, including those responsible for herpes simplex and other viral infections. The presence of amino groups at the 2 and 6 positions of the purine ring contributes to its biological activity. Ara-A is typically administered in a phosphorylated form, which is crucial for its incorporation into viral DNA, thereby disrupting the viral life cycle. Its pharmacological profile includes a relatively low toxicity to host cells, which is advantageous in therapeutic applications. Overall, Ara-A serves as an important compound in antiviral research and treatment, showcasing the significance of nucleoside analogs in modern medicine.
Formula:C10H14N6O4
InChI:InChI=1/C10H14N6O4/c11-7-4-8(15-10(12)14-7)16(2-13-4)9-6(19)5(18)3(1-17)20-9/h2-3,5-6,9,17-19H,1H2,(H4,11,12,14,15)/t3-,5-,6+,9-/m1/s1
Synonyms:- 9H-Purine-2,6-diamine, 9-beta-D-arabinofuranosyl-
- 2,6-Diamino Purine Arabinoside
- 2,6-Diaminopurine-9-arabinoside
- 9-(β-D-arabinofuranosyl)-2,6-Diamino-purine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
(2R,3S,4S,5R)-2-(2,6-Diamino-9H-purin-9-yl)-5-(hydroxymethyl)tetrahydrofuran-3,4-diol
CAS:Formula:C10H14N6O4Purity:98%Color and Shape:SolidMolecular weight:282.25602,6-Diamino-9-(b-D-arabinofuranosyl)purine
CAS:<p>2,6-Diamino-9-(b-D-arabinofuranosyl)purine is a synthetic purine nucleoside analog that contains modifications to the sugar component, making it different from the naturally occurring purine nucleosides found in DNA and RNA. These means it has the potential to interfere with nucleic acid synthesis, making it useful in research applications.</p>Formula:C10H14N6O4Purity:Min. 95%Color and Shape:PowderMolecular weight:282.26 g/mol2,6-Diaminopurine Arabinoside
CAS:Controlled ProductFormula:C10H14N6O4Color and Shape:NeatMolecular weight:282.26





