CAS 3408-97-7
:3-(4-bromophenyl)-1,1-dimethylurea
Description:
3-(4-Bromophenyl)-1,1-dimethylurea, with the CAS number 3408-97-7, is an organic compound that belongs to the class of ureas. It features a urea functional group, characterized by the presence of a carbonyl group (C=O) bonded to two nitrogen atoms (N). The compound has a bromophenyl substituent, which contributes to its chemical properties and reactivity. Typically, such compounds exhibit moderate solubility in organic solvents and may have limited solubility in water due to their hydrophobic aromatic components. The presence of the bromine atom can influence the compound's electronic properties, potentially enhancing its reactivity in electrophilic substitution reactions. Additionally, 3-(4-bromophenyl)-1,1-dimethylurea may exhibit biological activity, making it of interest in pharmaceutical research. Its structural characteristics can lead to various applications in agrochemicals or as intermediates in organic synthesis. As with many chemical substances, safety precautions should be observed when handling this compound due to potential toxicity and environmental impact.
Formula:C9H11BrN2O
InChI:InChI=1/C9H11BrN2O/c1-12(2)9(13)11-8-5-3-7(10)4-6-8/h3-6H,1-2H3,(H,11,13)
SMILES:CN(C)C(=O)Nc1ccc(cc1)Br
Synonyms:- 3-(4-Bromophényl)-1,1-diméthylurée
- 3-(4-Bromphenyl)-1,1-dimethylharnstoff
- 3408-97-7
- urea, N'-(4-bromophenyl)-N,N-dimethyl-
- 3-(4-Bromophenyl)-1,1-dimethylurea
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
1-(4-Bromophenyl)-3,3-dimethylurea
CAS:1-(4-Bromophenyl)-3,3-dimethylurea is a growth regulator that belongs to the heterocycle pyrazole derivative. It binds to the cytochrome P450 enzyme and inhibits the production of proteins vital for cell division, leading to cell death by inhibiting the production of proteins vital for cell division. 1-(4-Bromophenyl)-3,3-dimethylurea has been shown to inhibit methionine adenosyltransferase and suppress DNA methylation. This drug also has a toxic effect on respiratory system cells, which may be due to its ability to induce apoptosis.Formula:C9H11BrN2OPurity:Min. 95%Molecular weight:243.1 g/mol

