CAS 34086-50-5
:Alpinumisoflavone
Description:
Alpinumisoflavone is a naturally occurring flavonoid compound primarily found in certain plants, particularly in the genus *Alpinia*. It is characterized by its unique chemical structure, which includes a chromone backbone and various hydroxyl groups that contribute to its biological activity. This compound is known for its potential antioxidant, anti-inflammatory, and anticancer properties, making it of interest in pharmacological research. Alpinumisoflavone has been studied for its effects on various cellular processes, including apoptosis and cell proliferation, and may exhibit protective effects against oxidative stress. Additionally, it has been investigated for its potential role in modulating metabolic pathways. The compound's solubility and stability can vary depending on the solvent and environmental conditions, which are important factors for its application in both research and potential therapeutic contexts. Overall, Alpinumisoflavone represents a promising area of study within natural product chemistry and its implications for health and disease management.
Formula:C20H16O5
InChI:InChI=1S/C20H16O5/c1-20(2)8-7-13-15(25-20)9-16-17(18(13)22)19(23)14(10-24-16)11-3-5-12(21)6-4-11/h3-10,21-22H,1-2H3
InChI key:InChIKey=RQAMSFTXEFSBPK-UHFFFAOYSA-N
SMILES:O=C1C=2C(=CC3=C(C2O)C=CC(C)(C)O3)OC=C1C4=CC=C(O)C=C4
Synonyms:- 2H,6H-Benzo[1,2-b:5,4-b′]dipyran-6-one, 5-hydroxy-7-(p-hydroxyphenyl)-2,2-dimethyl-
- 2H,6H-benzo[1,2-b:5,4-b']dipyran-6-one, 5-hydroxy-7-(4-hydroxyphenyl)-2,2-dimethyl-
- 5-Hydroxy-7-(4-hydroxyphenyl)-2,2-dimethyl-2H,6H-benzo[1,2-b:5,4-b′]dipyran-6-one
- Alpinum-iso-flavone
- Alpinumisoflavone
- 5-Hydroxy-7-(4-hydroxyphenyl)-2,2-dimethyl-2H,6H-pyrano[3,2-g]chromen-6-one
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
5-Hydroxy-7-(4-hydroxyphenyl)-2,2-dimethyl-2H,6H-pyrano[3,2-g]chromen-6-one
CAS:5-Hydroxy-7-(4-hydroxyphenyl)-2,2-dimethyl-2H,6H-pyrano[3,2-g]chromen-6-onePurity:98%Molecular weight:336.34g/molAlpinumisoflavone
CAS:Alpinumisoflavone is a naturally occurring isoflavone, which is derived from plants, particularly those in the Leguminosae family. Structurally, isoflavones are a class of phytoestrogens, plant-derived compounds with estrogenic activity. Alpinumisoflavone exerts its effects primarily through its antioxidant and anti-inflammatory activities. It modulates key signaling pathways by interacting with cellular components to reduce oxidative stress and inhibit inflammatory responses, making it a valuable compound in studying cellular protection mechanisms.
Formula:C20H16O5Purity:Min. 95%Color and Shape:White PowderMolecular weight:336.34 g/molAlpinumisoflavone
CAS:Alpinumisoflavone has atheroprotective effects, may result from their ability to upregulate mechanisms promoting HDL-cholesterol and bile acid formation, it is endowed with estrogenic properties accounting, at least in part, for E. lysistemon effects. AlpFormula:C20H16O5Color and Shape:SolidMolecular weight:336.34
![5-Hydroxy-7-(4-hydroxyphenyl)-2,2-dimethyl-2H,6H-pyrano[3,2-g]chromen-6-one](/_next/image/?url=https%3A%2Fstatic.cymitquimica.com%2Fproducts%2F54%2Fthumb%2FOR1067208.jpg&w=3840&q=75)
