CAS 34086-51-6
:genistein 4',7-dimethyl ether
Description:
Genistein 4',7-dimethyl ether, with the CAS number 34086-51-6, is a flavonoid compound derived from the isoflavone class, which is primarily found in various plants, particularly soybeans. This compound exhibits a range of biological activities, including antioxidant, anti-inflammatory, and potential anticancer properties. Genistein and its derivatives, like the 4',7-dimethyl ether, are known for their ability to interact with estrogen receptors, which may influence hormonal activity in the body. The chemical structure of genistein 4',7-dimethyl ether includes multiple hydroxyl groups that contribute to its reactivity and biological activity. It is often studied for its potential health benefits, including its role in reducing the risk of certain diseases, such as osteoporosis and cardiovascular conditions. Additionally, due to its structural similarities to estrogen, it has garnered interest in research related to hormone-related cancers. Overall, genistein 4',7-dimethyl ether represents a significant area of study in phytochemistry and medicinal research.
Formula:C17H14O5
InChI:InChI=1/C17H14O5/c1-20-11-5-3-10(4-6-11)13-9-22-15-8-12(21-2)7-14(18)16(15)17(13)19/h3-9,18H,1-2H3
SMILES:COc1ccc(cc1)c1coc2cc(cc(c2c1=O)O)OC
Synonyms:- 5-Hydroxy-4',7-dimethoxyisoflavone
- 7,4'-Dimethoxy-5-hydroxyisoflavone
- Genistein-7,4'-dimethyl ether
- Nsc 604926
- 4H-1-Benzopyran-4-one, 5-hydroxy-7-methoxy-3-(4-methoxyphenyl)-
- 5-hydroxy-7-methoxy-3-(4-methoxyphenyl)-4H-chromen-4-one
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
Genistein-4',7-dimethylether
CAS:Genistein-4',7-dimethylether analytical standard provided with chromatographic purity, to be used as reference material for qualitative determination.Formula:C17H14O5Purity:(HPLC) ≥95%Color and Shape:PowderMolecular weight:298.35-Hydroxy-7-methoxy-3-(4-methoxyphenyl)-4H-chromen-4-one
CAS:Formula:C17H14O5Purity:97%Color and Shape:SolidMolecular weight:298.29017-O-Methylbiochanin A
CAS:7-O-Methylbiochanin A (4',7-Dimethoxy-5-hydroxyisoflavone) is an isoflavone derivative that can be isolated from the roots of Lotus polyphyllos and other plantsFormula:C17H14O5Purity:99.00%Color and Shape:SolidMolecular weight:298.29Ref: TM-TN1333
1mg63.00€5mg133.00€1mL*10mM (DMSO)140.00€10mg192.00€25mg318.00€50mg462.00€100mg637.00€200mg858.00€Biochanin A-7-methyl ether
CAS:Biochanin A-7-methyl ether is a naturally occurring isoflavone, which is derived from plant sources such as the Fabaceae family. It is a methylated derivative of the isoflavone biochanin A. The compound is predominantly obtained through extraction and purification processes from specific plant materials known to contain isoflavones.
Formula:C17H14O5Purity:Min. 98 Area-%Color and Shape:PowderMolecular weight:298.29 g/mol







