CAS 34086-52-7

Derrone-4′-O-methyl ether

Description:

Derrone-4′-O-methyl ether, identified by its CAS number 34086-52-7, is a chemical compound that belongs to the class of flavonoids, which are known for their diverse biological activities and potential health benefits. This compound features a methoxy group at the 4′ position of the derrone structure, which may influence its solubility and reactivity. Flavonoids, including derivatives like derrone-4′-O-methyl ether, are characterized by their polyphenolic structure, typically consisting of two aromatic rings connected by a three-carbon bridge. These compounds are often recognized for their antioxidant properties, which can help neutralize free radicals in biological systems. Additionally, they may exhibit anti-inflammatory, antimicrobial, and anticancer activities, making them of interest in pharmacological research. The specific characteristics, such as melting point, boiling point, and solubility, can vary and are typically determined through experimental methods. Overall, derrone-4′-O-methyl ether represents a fascinating area of study within natural products and medicinal chemistry.

Formula: C₂₁H₁₈O₅

InChI: InChI=1S/C21H18O5/c1-21(2)9-8-14-17(26-21)10-16(22)18-19(23)15(11-25-20(14)18)12-4-6-13(24-3)7-5-12/h4-11,22H,1-3H3

InChI key: InChIKey=TYGQXJXSHGOEKP-UHFFFAOYSA-N

SMILES: O=C1C2=C(C3=C(C=C2O)OC(C)(C)C=C3)OC=C1C4=CC=C(OC)C=C4

Synonyms:

• 4H,8H-Benzo[1,2-b:3,4-b′]dipyran-4-one, 5-hydroxy-3-(4-methoxyphenyl)-8,8-dimethyl-
• 5-Hydroxy-3-(4-methoxyphenyl)-8,8-dimethyl-4H,8H-benzo[1,2-b:3,4-b′]dipyran-4-one
• Derrone-4′-O-methyl ether
• 4H,8H-Benzo[1,2-b:3,4-b′]dipyran-4-one, 5-hydroxy-3-(p-methoxyphenyl)-8,8-dimethyl-

Derrone-4'-methyl ether

CAS: 34086-52-7

Derrone-4'-methyl ether is a flavonoid derivative, which is a compound class known for diverse biological activities. This compound is sourced from the isoflavonoid family, predominantly found in legumes and other plant species. Isoflavonoids are secondary metabolites that play crucial roles in plant defense mechanisms and interactions with the environment.

Formula: C₂₁H₁₈O₅

Purity: Min. 95%

Molecular weight: 350.36 g/mol

Ref: 3D-XD161700