CAS 340963-86-2
:Araliasaponin V
Description:
Araliasaponin V is a triterpenoid saponin derived from the Aralia genus, particularly from plants like Aralia elata. It is characterized by its complex structure, which typically includes a steroid-like backbone with sugar moieties attached, contributing to its amphiphilic nature. This compound exhibits various biological activities, including potential anti-inflammatory, antioxidant, and cytotoxic effects, making it of interest in pharmacological research. Araliasaponin V is soluble in water due to its saponin structure, which allows it to form micelles and interact with biological membranes. Its unique properties are attributed to the specific arrangement of glycosidic linkages and functional groups, which influence its reactivity and interaction with other molecules. As with many saponins, it may also exhibit foaming properties when agitated in aqueous solutions. Research into Araliasaponin V continues to explore its potential therapeutic applications and mechanisms of action within biological systems.
Formula:C54H88O23
InChI:InChI=1S/C54H88O23/c1-49(2)14-16-54(48(69)77-46-41(68)38(65)34(61)27(21-57)72-46)17-15-52(6)23(24(54)18-49)8-9-30-51(5)12-11-31(50(3,4)29(51)10-13-53(30,52)7)74-47-43(76-45-40(67)37(64)33(60)26(20-56)71-45)42(35(62)28(22-58)73-47)75-44-39(66)36(63)32(59)25(19-55)70-44/h8,24-47,55-68H,9-22H2,1-7H3/t24-,25+,26+,27+,28+,29-,30+,31-,32+,33+,34+,35+,36-,37-,38-,39+,40+,41+,42-,43+,44-,45-,46-,47-,51-,52+,53+,54-/m0/s1
InChI key:InChIKey=MROYUZKXUGPCPD-WEHHMEJFSA-N
SMILES:C(O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O)(=O)[C@]23[C@](C=4[C@@](C)(CC2)[C@@]5(C)[C@](CC4)([C@]6(C)[C@@](CC5)(C(C)(C)[C@@H](O[C@H]7[C@H](O[C@@H]8O[C@H](CO)[C@@H](O)[C@H](O)[C@H]8O)[C@@H](O[C@@H]9O[C@H](CO)[C@@H](O)[C@H](O)[C@H]9O)[C@H](O)[C@@H](CO)O7)CC6)[H])[H])(CC(C)(C)CC3)[H]
Synonyms:- Araliasaponin V
- Araliasaponin V (Aralia elata)
- Araloside V
- Congmunoside V
- Olean-12-en-28-oic acid, 3-[(O-β-<span class="text-smallcaps">D</smallcap>-glucopyranosyl-(1→2)-O-[β-<smallcap>D</smallcap>-glucopyranosyl-(1→3)]-β-<smallcap>D</smallcap>-glucopyranosyl)oxy]-, β-<smallcap>D</span>-glucopyranosyl ester, (3β)-
- Olean-12-en-28-oic acid, 3-[(O-β-D-glucopyranosyl-(1→2)-O-[β-D-glucopyranosyl-(1→3)]-β-D-glucopyranosyl)oxy]-, β-D-glucopyranosyl ester, (3β)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Araloside V
CAS:<p>Araloside V (Congmunoside V) comes from the roots of Aralia elata. It can be used to treat neurasthenia.</p>Formula:C54H88O23Purity:98%Color and Shape:SolidMolecular weight:1105.26CongmunosideV
CAS:<p>Congmunoside V is a triterpenoid saponin, which is a bioactive compound isolated from the plant Gynostemma pentaphyllum, also known as Jiaogulan. This plant is traditionally recognized in herbal medicine and is a member of the Cucurbitaceae family, primarily found in East Asia. Triterpenoid saponins are a class of chemical compounds composed of a sapogenin (triterpene) attached to sugar moieties, which confer a variety of biological activities.</p>Purity:Min. 95%




