CAS 34098-18-5

3-Chloro-4,5-dihydroxybenzaldehyde

Description:

3-Chloro-4,5-dihydroxybenzaldehyde, with the CAS number 34098-18-5, is an organic compound characterized by its aromatic structure featuring a benzaldehyde functional group, two hydroxyl (-OH) groups, and a chlorine atom. This compound typically appears as a solid at room temperature and is soluble in polar solvents due to the presence of hydroxyl groups, which can engage in hydrogen bonding. The chlorine substituent introduces unique reactivity, influencing its chemical behavior and potential applications in organic synthesis. The dihydroxy substitution pattern can enhance its reactivity in electrophilic aromatic substitution reactions. Additionally, the compound may exhibit biological activity, making it of interest in medicinal chemistry and research. Its properties, such as melting point, boiling point, and spectral characteristics, can vary based on purity and environmental conditions. Overall, 3-Chloro-4,5-dihydroxybenzaldehyde serves as a valuable intermediate in the synthesis of various chemical compounds and may have implications in pharmaceuticals and agrochemicals.

Formula: C₇H₅ClO₃

InChI: InChI=1/C7H5ClO3/c8-5-1-4(3-9)2-6(10)7(5)11/h1-3,10-11H

SMILES: c1c(cc(c(c1Cl)O)O)C=O

Synonyms:

• Benzaldehyde, 3-Chloro-4,5-Dihydroxy-

Benzaldehyde,3-chloro-4,5-dihydroxy-

CAS: 34098-18-5

Formula: C₇H₅ClO₃

Purity: 97%

Color and Shape: Solid

Molecular weight: 172.5658

Ref: IN-DA007HCD

3-Chloro-4,5-dihydroxybenzaldehyde

CAS: 34098-18-5

3-Chloro-4,5-dihydroxybenzaldehyde

Purity: 97%

Molecular weight: 172.57g/mol

Ref: 54-OR1036129

3-Chloro-4,5-dihydroxybenzaldehyde

CAS: 34098-18-5

Purity: 97%

Molecular weight: 172.5599976

Ref: 10-F718457